SNC-80

{{Short description|Opioid analgesic drug}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 464385560

| IUPAC_name = 4-[(R)-[(2S,5R)-4-allyl-2,5-dimethylpiperazin-1-yl](3-methoxyphenyl)methyl]-N,N-diethylbenzamide

| image = SNC-80 Structure.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 156727-74-1

| ATC_prefix =

| ATC_suffix =

| PubChem = 123924

| IUPHAR_ligand = 1611

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = L842QB22SW

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 110453

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 13470

| ChEBI = 231727

| C=28 | H=39 | N=3 | O=2

| smiles = O=C(N(CC)CC)c1ccc(cc1)[C@@H](N2C[C@H](N(C\C=C)C[C@@H]2C)C)c3cccc(OC)c3

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C28H39N3O2/c1-7-17-30-19-22(5)31(20-21(30)4)27(25-11-10-12-26(18-25)33-6)23-13-15-24(16-14-23)28(32)29(8-2)9-3/h7,10-16,18,21-22,27H,1,8-9,17,19-20H2,2-6H3/t21-,22+,27-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = KQWVAUSXZDRQPZ-UMTXDNHDSA-N

| synonyms = SNC-80

}}

SNC-80 is an opioid analgesic compound that selectively activates μ–δ opioid receptor heteromers{{cite journal |vauthors=Metcalf MD, Yekkirala AS, Powers MD, Kitto KF, Fairbanks CA, Wilcox GL, Portoghese PS |date=July 2012 |title=The δ opioid receptor agonist SNC80 selectively activates heteromeric μ-δ opioid receptors |journal=ACS Chemical Neuroscience |volume=3 |issue=7 |pages=505–9 |doi=10.1021/cn3000394 |pmc=3399572 |pmid=22860219}} and is used primarily in scientific research.{{cite journal |vauthors=Calderon SN, Coop A |year=2004 |title=SNC 80 and related delta opioid agonists |journal=Current Pharmaceutical Design |volume=10 |issue=7 |pages=733–42 |doi=10.2174/1381612043453054 |pmid=15032699}} Discovered in 1994, SNC-80 was a pioneering non-peptide compound regarded as a highly selective agonist for the δ-opioid receptor.{{cite journal |display-authors=6 |vauthors=Calderon SN, Rothman RB, Porreca F, Flippen-Anderson JL, McNutt RW, Xu H, Smith LE, Bilsky EJ, Davis P, Rice KC |date=July 1994 |title=Probes for narcotic receptor mediated phenomena. 19. Synthesis of (+)-4-[(alpha R)-alpha-((2S,5R)-4-allyl-2,5-dimethyl-1-piperazinyl)-3- methoxybenzyl]-N,N-diethylbenzamide (SNC 80): a highly selective, nonpeptide delta opioid receptor agonist |journal=Journal of Medicinal Chemistry |volume=37 |issue=14 |pages=2125–8 |doi=10.1021/jm00040a002 |pmid=8035418}}

SNC-80 was the first non-peptide compound developed that was regarded as a highly selective agonist for the δ-opioid receptor.{{cite journal | vauthors = Bilsky EJ, Calderon SN, Wang T, Bernstein RN, Davis P, Hruby VJ, McNutt RW, Rothman RB, Rice KC, Porreca F | display-authors = 6 | title = SNC 80, a selective, nonpeptidic and systemically active opioid delta agonist | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 273 | issue = 1 | pages = 359–66 | date = April 1995 | pmid = 7714789 }}

It has been shown to produce useful analgesic,{{cite journal |vauthors=Gallantine EL, Meert TF |date=July 2005 |title=A comparison of the antinociceptive and adverse effects of the mu-opioid agonist morphine and the delta-opioid agonist SNC80 |journal=Basic & Clinical Pharmacology & Toxicology |volume=97 |issue=1 |pages=39–51 |doi=10.1111/j.1742-7843.2005.pto_97107.x |pmid=15943758}} antidepressant{{cite journal | vauthors = Jutkiewicz EM, Rice KC, Traynor JR, Woods JH | title = Separation of the convulsions and antidepressant-like effects produced by the delta-opioid agonist SNC80 in rats | journal = Psychopharmacology | volume = 182 | issue = 4 | pages = 588–96 | date = November 2005 | pmid = 16163520 | pmc = 1307499 | doi = 10.1007/s00213-005-0138-9 }} and anxiolytic effects in animal studies,{{cite journal | vauthors = Perrine SA, Hoshaw BA, Unterwald EM | title = Delta opioid receptor ligands modulate anxiety-like behaviors in the rat | journal = British Journal of Pharmacology | volume = 147 | issue = 8 | pages = 864–72 | date = April 2006 | pmid = 16491101 | pmc = 1760715 | doi = 10.1038/sj.bjp.0706686 }}{{cite journal | vauthors = Saitoh A, Kimura Y, Suzuki T, Kawai K, Nagase H, Kamei J | title = Potential anxiolytic and antidepressant-like activities of SNC80, a selective delta-opioid agonist, in behavioral models in rodents | journal = Journal of Pharmacological Sciences | volume = 95 | issue = 3 | pages = 374–80 | date = July 2004 | pmid = 15272214 | doi = 10.1254/jphs.FPJ04014X | doi-access = free }} but its usefulness is limited by producing convulsions at high doses,{{cite journal | vauthors = Danielsson I, Gasior M, Stevenson GW, Folk JE, Rice KC, Negus SS | title = Electroencephalographic and convulsant effects of the delta opioid agonist SNC80 in rhesus monkeys | journal = Pharmacology, Biochemistry, and Behavior | volume = 85 | issue = 2 | pages = 428–34 | date = October 2006 | pmid = 17112570 | pmc = 1820742 | doi = 10.1016/j.pbb.2006.09.012 }} and so SNC-80 is not used medically, although it is a useful compound in scientific research.