SR-57227
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 1-(6-chloropyridin-2-yl)piperidin-4-amine
| image = SR-57227_structure.png
| width = 240
| tradename =
| legal_status =
| routes_of_administration =
| metabolism =
| elimination_half-life =
| excretion =
| IUPHAR_ligand = 4316
| CAS_number = 77145-61-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = OW45B79UZD
| PubChem = 131747
| ChemSpiderID = 116402
| C=10 | H=14 | Cl=1 | N=3
| smiles = ClC1=CC=CC(N2CCC(N)CC2)=N1
| StdInChI = 1S/C10H14ClN3/c11-9-2-1-3-10(13-9)14-6-4-8(12)5-7-14/h1-3,8H,4-7,12H2
| StdInChIKey = WPVVMKYQOMJPIN-UHFFFAOYSA-N
}}
SR-57227 is a potent and selective agonist at the 5HT3 receptor, with high selectivity over other serotonin receptor subtypes and good blood–brain barrier penetration.{{cite journal | vauthors = Bachy A, Héaulme M, Giudice A, Michaud JC, Lefevre IA, Souilhac J, Manara L, Emerit MB, Gozlan H, Hamon M | display-authors = 6 | title = SR 57227A: a potent and selective agonist at central and peripheral 5-HT3 receptors in vitro and in vivo | journal = European Journal of Pharmacology | volume = 237 | issue = 2–3 | pages = 299–309 | date = June 1993 | pmid = 7689975 | doi = 10.1016/0014-2999(93)90282-M }}{{cite journal | vauthors = Maksay G, Simonyi M, Bikádi Z | title = Subunit rotation models activation of serotonin 5-HT3AB receptors by agonists | journal = Journal of Computer-Aided Molecular Design | volume = 18 | issue = 10 | pages = 651–64 | date = October 2004 | pmid = 15849995 | doi = 10.1007/s10822-004-6259-0 | s2cid = 10510254 }}{{cite journal | vauthors = Yoo JH, Cho JH, Yu HS, Lee KW, Lee BH, Jeong SM, Nah SY, Kim HC, Lee SY, Jang CG | display-authors = 6 | title = Involvement of 5-HT receptors in the development and expression of methamphetamine-induced behavioral sensitization: 5-HT receptor channel and binding study | journal = Journal of Neurochemistry | volume = 99 | issue = 3 | pages = 976–88 | date = November 2006 | pmid = 16942594 | doi = 10.1111/j.1471-4159.2006.04137.x | s2cid = 38685481 | doi-access = free }}{{cite journal | vauthors = Li Y, Raaby KF, Sánchez C, Gulinello M | title = Serotonergic receptor mechanisms underlying antidepressant-like action in the progesterone withdrawal model of hormonally induced depression in rats | journal = Behavioural Brain Research | volume = 256 | pages = 520–8 | date = November 2013 | pmid = 24016840 | doi = 10.1016/j.bbr.2013.09.002 | s2cid = 45617581 }}
References
{{Reflist|2}}
{{Serotonergics}}
Category:Serotonin receptor agonists
Category:Disubstituted pyridines
{{nervous-system-drug-stub}}