SR9009

{{Short description|Chemica compound, Agonist of Rev-ErbA}}

{{Drugbox

| IUPAC_name = ethyl-3-(((4-chlorobenzyl)((5-nitrothiophen-2-yl)methyl)amino)methyl)pyrrolidine-1-carboxylate

| image = SR9009 structure.svg

| width = 240

| tradename =

| pregnancy_AU =

| pregnancy_US =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| CAS_number = 1379686-30-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = X5DCA09N30

| PubChem = 57394020

| C= 20 | H= 24 | Cl = 1 | N= 3 | O= 4 | S = 1

| smiles = CCOC(=O)N1CCC(C1)CN(CC2=CC=C(C=C2)Cl)CC3=CC=C(S3)[N+](=O)[O-]

| StdInChI = 1S/C20H24ClN3O4S/c1-2-28-20(25)23-10-9-16(13-23)12-22(11-15-3-5-17

(21)6-4-15)14-18-7-8-19(29-18)24(26)27/h3-8,16H,2,9-14H2,1H3

| StdInChIKey = MMJJNHOIVCGAAP-UHFFFAOYSA-N

| ChemSpiderID = 28487410

| ChEMBL = 1961796

}}

SR9009, also known as Stenabolic, is a research drug that was developed by professor Thomas Burris of the Scripps Research Institute as an agonist of Rev-ErbA (i.e., increases the constitutive repression of genes regulated by Rev-ErbA){{cite web | url = http://www.gizmag.com/scripps-drug-sr9009-exercise-mimic/28651/ | title = New drug mimics the beneficial effects of exercise | author = Dodson B | date = 2013-08-20 |website=Gizmag | access-date = 2013-08-21 }} with a half-maximum inhibitory concentration (IC50) = 670 nM for Rev-ErbAα and IC50 = 800 nM for Rev-ErbAβ.{{cite journal | vauthors = Solt LA, Wang Y, Banerjee S, Hughes T, Kojetin DJ, Lundasen T, Shin Y, Liu J, Cameron MD, Noel R, Yoo SH, Takahashi JS, Butler AA, Kamenecka TM, Burris TP | display-authors = 6 | title = Regulation of circadian behaviour and metabolism by synthetic REV-ERB agonists | journal = Nature | volume = 485 | issue = 7396 | pages = 62–68 | date = March 2012 | pmid = 22460951 | pmc = 3343186 | doi = 10.1038/nature11030 | bibcode = 2012Natur.485...62S }} In an animal study, some of its effects were found to be independent of REV-ERB with an unknown mechanism of action.{{cite journal | vauthors = Dierickx P, Emmett MJ, Jiang C, Uehara K, Liu M, Adlanmerini M, Lazar MA | title = SR9009 has REV-ERB-independent effects on cell proliferation and metabolism | journal = Proceedings of the National Academy of Sciences of the United States of America | volume = 116 | issue = 25 | pages = 12147–12152 | date = June 2019 | pmid = 31127047 | doi = 10.1073/pnas.1904226116 | pmc = 6589768 | bibcode = 2019PNAS..11612147D | doi-access = free }}

Activation of Rev-ErbA-α by SR9009 in mice increases exercise capacity by increasing mitochondria counts in skeletal muscle.{{cite journal | vauthors = Woldt E, Sebti Y, Solt LA, Duhem C, Lancel S, Eeckhoute J, Hesselink MK, Paquet C, Delhaye S, Shin Y, Kamenecka TM, Schaart G, Lefebvre P, Nevière R, Burris TP, Schrauwen P, Staels B, Duez H | display-authors = 6 | title = Rev-erb-α modulates skeletal muscle oxidative capacity by regulating mitochondrial biogenesis and autophagy | journal = Nature Medicine | volume = 19 | issue = 8 | pages = 1039–1046 | date = August 2013 | pmid = 23852339 | pmc = 3737409 | doi = 10.1038/nm.3213 }}

Abuse of SR9009 has been reported within the bodybuilding community, resulting in SR9009 being placed on the World Anti-Doping Agency list of prohibited drugs. SR9009 and the related SR9011 drug are described as "Hormone and Metabolic Modulators".{{cite web | url = https://www.wada-ama.org/en/resources/science-medicine/prohibited-list-documents | title = Prohibited List| date = 2014-07-22}}{{cite journal | vauthors = Mazzarino M, Rizzato N, Stacchini C, de la Torre X, Botrè F | title = A further insight into the metabolic profile of the nuclear receptor Rev-erb agonist, SR9009 | journal = Drug Testing and Analysis | volume = 10 | issue = 11–12 | pages = 1670–1681 | date = November 2018 | pmid = 30395700 | doi = 10.1002/dta.2538 | hdl-access = free | hdl = 11573/1291262 | s2cid = 53223664 }}

See also

References