Sappanone A

{{Chembox

| ImageFile = Sappanone A.svg

| ImageSize = 200px

| ImageAlt = Chemical structure of sappanone A

| IUPACName = [1′a(3)E]-3′,4′,7-Trihydroxy-2H-1′(3)a-homoisoflav-1′a(3)-en-4-one

| SystematicName = (3E)-3-[(3,4-Dihydroxyphenyl)methylidene]-7-hydroxy-2,3-dihydro-4H-1-benzopyran-4-one

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 104778-14-5

| CASNo1_Ref = {{cascite|correct|CAS}}

| CASNo1 = 102067-84-5

| CASNo1_Comment = (non-specific)

| CASNo2_Ref = {{cascite|correct|CAS}}

| CASNo2 = 112458-02-3

| CASNo2_Comment = (non-specific)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 659E9Z3J5X

| ChemSpiderID = 7993024

| PubChem = 9817274

| SMILES = C1/C(=C\C2=CC(=C(C=C2)O)O)/C(=O)C3=C(O1)C=C(C=C3)O

}}

|Section2={{Chembox Properties

| C =16 | H = 12 | O = 5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Sappanone A is a homoisoflavanone that can be found in Caesalpinia sappan.{{cite journal|pmc=3431864|year=2012|last1=Chang|first1=T. S.|title=Melanogenesis Inhibition by Homoisoflavavone Sappanone a from Caesalpinia sappan|journal=International Journal of Molecular Sciences|volume=13|issue=8|pages=10359–10367|last2=Chao|first2=S. Y.|last3=Ding|first3=H. Y.|doi=10.3390/ijms130810359|pmid=22949866|doi-access=free}}