Sarcophagine

{{Chembox

| ImageFile = Sarcophagine.svg

| ImageSize = 200px

| ImageAlt =

| PIN = 3,6,10,13,16,19-Hexazabicyclo[6.6.6]icosane

| OtherNames = Sar chelate

| Section1 = {{Chembox Identifiers

| CASNo = 64189-50-0

| CASNo_Ref = {{Cascite|correct|ChemSpider}}

| ChemSpiderID = 4908238

| DTXSID = DTXSID30214390

| PubChem = 6394006

| SMILES = C1CNCC2CNCCNCC(CN1)CNCCNC2

| InChI=1S/C14H32N6/c1-2-16-8-14-11-19-5-3-17-9-13(7-15-1)10-18-4-6-20-12-14/h13-20H,1-12H2

| InChIKey=NVOVSXGZALWAFS-UHFFFAOYSA-N

}}

| Section2 = {{Chembox Properties

| C=14|H=32|N=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Sarcophagine (Sar) is a bicyclic cage-like metal chelator molecule{{Cite journal|url=http://www.thno.org/v02p0589.htm|title=The Efficient Synthesis and Biological Evaluation of Novel Bi-Functionalized Sarcophagine for 64Cu Radiopharmaceuticals|journal=Theranostics|date=2012 |doi=10.7150/thno.4295 |language=en|access-date=2017-10-06 |last1=Liu |first1=Shuanglong |last2=Li |first2=Dan |last3=Huang |first3=Chiun-Wei |last4=Yap |first4=Li-Peng |last5=Park |first5=Ryan |last6=Shan |first6=Hong |last7=Li |first7=Zibo |last8=Conti |first8=Peter S. |volume=2 |issue=6 |pages=589–596 |pmid=22737194 |pmc=3381345 }} derived from cyclam. Chemical formula of sarcophagine is 3,6,10,13,16,19-hexaazabicyclo(6,6,6)icosane{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/146286|title=Diamsar chelate|last=Pubchem|website=pubchem.ncbi.nlm.nih.gov|language=en|access-date=2017-10-06}} and additional functional groups are often linked to this structure, such as in DiAmSar (1,8-diamino-Sar). This and many related hexadentate clathrochelates are prepared by template reactions.{{cite journal|author1=Gahan, L. R. |author2=Harrowfield, J. M. |title=Sepulchrate: Four decades on|journal=Polyhedron|year=2015|volume=94|pages=1–51|doi=10.1016/j.poly.2015.03.036}}

:File:DiAmSar.svg{{clear-left}}

Sarcophagine derivatives are used, for example, as ligands in radiopharmaceuticals that require incorporating a radioactive metal cation into an organic and/or biological structure, such as an antibody.{{Cite journal|last1=Liu|first1=Shuanglong|last2=Li|first2=Zibo|last3=Conti|first3=Peter S.|date=2014-04-03|title=Development of Multi-Functional Chelators Based on Sarcophagine Cages|journal=Molecules|language=en|volume=19|issue=4|pages=4246–4255|doi=10.3390/molecules19044246|pmid=24705567|pmc=6270798|doi-access=free}}