Saredutant

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 464387259

| IUPAC_name = N-[(2S)-4-(4-acetamido-4-phenylpiperidin-1-yl)- 2-(3,4-dichlorophenyl)butyl]-N-methylbenzamide

| image = Saredutant.svg

| width = 250

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 142001-63-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 720U2QK8I5

| ATC_prefix = none

| ATC_suffix =

| PubChem = 104974

| IUPHAR_ligand = 2111

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 94726

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 308148

| C=31 | H=35 | Cl=2 | N=3 | O=2

| smiles = Clc1ccc(cc1Cl)[C@H](CCN3CCC(c2ccccc2)(NC(=O)C)CC3)CN(C(=O)c4ccccc4)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C31H35Cl2N3O2/c1-23(37)34-31(27-11-7-4-8-12-27)16-19-36(20-17-31)18-15-26(25-13-14-28(32)29(33)21-25)22-35(2)30(38)24-9-5-3-6-10-24/h3-14,21,26H,15-20,22H2,1-2H3,(H,34,37)/t26-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PGKXDIMONUAMFR-AREMUKBSSA-N

}}

Saredutant (SR-48,968) is a drug that acts as a NK₂ receptor antagonist.{{cite journal | vauthors = Hopkins CR | title = ACS chemical neuroscience molecule spotlight on Saredutant | journal = ACS Chemical Neuroscience | volume = 1 | issue = 10 | pages = 653–4 | date = October 2010 | pmid = 22776916 | pmc = 3368631 | doi = 10.1021/cn100061r }} It was under development by Sanofi-Aventis as a novel antidepressant and anxiolytic and made it to phase III clinical trials. However, in May 2009, Sanofi-Aventis published its quarterly results and announced the cessation of 14 research/development projects, among which was saredutant for the treatment of major depressive disorder.{{cite web | url = http://www.sanofi-aventis.com/binaries/Lettre18_FR_Web_acc_tcm29-25341.pdf | archive-url = https://web.archive.org/web/20101221023128/http://www.sanofi-aventis.com/binaries/Lettre18_FR_Web_acc_tcm29-25341.pdf | archive-date = 21 December 2010 | title = Letter to the stockholders of Sanofi-Aventis | date = May 2009 }}