Scammonin I

{{single-source|date=May 2025}}

{{chembox

| Name = Scammonin I

| verifiedrevid = 373574651

| ImageFile = Scammonin I.png

| IUPACName = Hexadecanoic acid, 11-((O-(E)-6-deoxy-4-O-(2-methyl-1-oxo-2-butenyl)-β-D-glucopyranosyl-(1→4)-O-(S)-6-deoxy-2-O-(2-methyl-1-oxobutyl)-α-L-mannopyranosyl-(1→2)-O-β-D-glucopyranosyl-(1→2)-6-deoxy-beta-D-glucopyranosyl))

| OtherNames = Jalapin, Scammonium

|Section1={{Chembox Identifiers

| Abbreviations =

| CASNo_Ref =

| CASNo = 131747-25-6

| EINECS =

| PubChem = 44593484

| ChemSpiderID = 23339064

| SMILES = O=C(CCCCCCCCC[C@H](CCCCC)O[C@H]1[C@@]2([H])[C@@H](O)[C@H](O)[C@@H](C)O1)O[C@H]([C@](O[C@@H]3O[C@H](C)[C@@H](OC(/C(C)=C/C)=O)[C@H](O)[C@H]3O)([H])[C@H](C)O4)[C@@H](OC([C@H](CC)C)=O)[C@@H]4O[C@@]5([H])[C@H](O2)O[C@H](CO)[C@@H](O)[C@@H]5O

| StdInChI = 1S/C50H84O21/c1-9-12-18-21-30-22-19-16-14-13-15-17-20-23-32(52)66-43-40(69-47-38(58)37(57)39(28(7)62-47)67-45(59)25(4)10-2)29(8)63-50(44(43)68-46(60)26(5)11-3)71-42-36(56)34(54)31(24-51)65-49(42)70-41-35(55)33(53)27(6)61-48(41)64-30/h10,26-31,33-44,47-51,53-58H,9,11-24H2,1-8H3/b25-10+/t26-,27+,28+,29-,30-,31+,33+,34+,35-,36-,37+,38+,39+,40-,41+,42+,43+,44+,47-,48-,49-,50-/m0/s1

| StdInChIKey = DGRGOOVTCYVEDQ-GHYHFUIZSA-N

| RTECS =

| MeSHName =

| ChEBI =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

}}

|Section2={{Chembox Properties

| C=50 | H=84 | O=21

| Appearance =

| Density =

| MeltingPtC =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| pKa =

| pKb = }}

|Section7={{Chembox Hazards

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| HPhrases =

| PPhrases =

| GHS_ref =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| PEL = }}

}}

Scammonin (also known as jalapin or scammonium{{cite journal | pmid = 1367262 | year = 1990 | last1 = Noda | first1 = N | last2 = Kogetsu | first2 = H | last3 = Kawasaki | first3 = T | last4 = Miyahara | first4 = K | title = Scammonins I and II, the resin glycosides of radix scammoniae from Convolvulus scammonia | volume = 29 | issue = 11 | pages = 3565–9 | journal = Phytochemistry | doi = 10.1016/0031-9422(90)85277-M| bibcode = 1990PChem..29.3565N }}) is a lipid glycoside that has been isolated from Ipomoea purga (jalap or John the Conqueror root) and from Convolvulus scammonia (scammony).