Scarlet GN

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 464387733

| ImageFile = Scarlet_GN.svg

| ImageFile_Ref = {{chemboximage|correct|??}}

| ImageName = Kekulé, canonical skeletal formula of scarlet GN ((6E)-6-hydrazinylidene)

| SystematicName = Disodium 3-[(2,4-Dimethyl-5-sulfonatophenyl)hydrazinylidene]-4-oxonaphthalene-1-sulfonate

| OtherNames = {{Unbulleted list|Crimson 4R|C.I. Food Red 1|Food red 1|FD & C Red no. 4|Hexacol Ponceau SX|Maple Ponceau SX|Ponceau SX|Purple 4R|E125}}

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 4548-53-2

| CASNo_Comment = (Z)

| PubChem = 6537642

| PubChem_Comment = (Z)

| PubChem1 = 5483118

| PubChem1_Comment = (E)

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = X3W0AM1JLX

| ChemSpiderID = 5020702

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID_Comment = (Z)

| EINECS = 221-856-3

| SMILES = [Na+].Cc3cc(S(=O)(=O)[O-])c(N=Nc2c(O)c1c(cc2)c(S(=O)(=O)[O-])ccc1)c(C)c3.[Na+]

| SMILES1 = CC1=CC(=C(NN=C2C=CC3=C(C=CC=C3C2=O)S(=O)(=O)O[Na])C(C)=C1)S(=O)(=O)O[Na]

| StdInChI = 1S/C18H16N2O7S2.2Na/c1-10-8-11(2)17(16(9-10)29(25,26)27)20-19-14-7-6-12-13(18(14)21)4-3-5-15(12)28(22,23)24;;/h3-9,20H,1-2H3,(H,22,23,24)(H,25,26,27);;/q;2*+1/p-2/b19-14-;;

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = AQJHOKDCKYSJAS-MHZTUVSFSA-L

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

}}

|Section2={{Chembox Properties

| C=18 | H=14 | N=2 | Na=2 | O=7 | S=2

}}

}}

Scarlet GN, or C.I. Food Red 2, FD&C Red No. 4, or C.I. 14815 is a red azo dye once used as a food dye. As a food additive, it has the E number E125. It is usually used as a disodium salt.

In the United States, it is not permitted for use in food or ingested drugs and may only be used in externally applied drugs and cosmetics, due to potential carcinogenic effects from ingesting it.{{CodeFedReg|21|81|10}}{{CodeFedReg|21|81|30}}{{CodeFedReg|21|82|304}} An exception was added in 1965 to allow its use in the coloring of maraschino cherries, which were considered mainly decorative and not a foodstuff.{{cite book |last=Pavia|first=Donald L.|year=2005|title=Introduction to Organic Laboratory Techniques: A Small Scale Approach|edition=2nd |pages=387–389|publisher=Thomson Brooks/Cole |isbn=0534408338|url=https://books.google.com/books?id=ega5c11VHvkC|accessdate=January 25, 2013}} This exception was repealed and the dye banned in the US on September 22, 1976 due to mounting safety concerns.{{Cite news |date=September 23, 1976 |title=F.D.I. Bans Use of Red No. 4 Dye And Carbon Black in Food Items |url=https://www.nytimes.com/1976/09/23/archives/fdi-bans-use-of-red-no-4-dye-and-carbon-black-in-food-items.html |access-date=20 February 2025 |work=New York Times}} In the European Union, it is not permitted as a food additive.[http://www.food.gov.uk/safereating/chemsafe/additivesbranch/enumberlist Current EU approved additives and their E Numbers], Food Standards Agency