Scriptaid

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 6-(1,3-Dioxobenzo[de]isoquinolin-2-yl)-N-hydroxyhexanamide

| image = Scriptaid_structure.png

| width = 220

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| bioavailability =

| protein_bound =

| metabolism =

| excretion =

| IUPHAR_ligand =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 287383-59-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = EJQ8CD8BSV

| CAS_supplemental =

| ATC_prefix = none

| ATC_suffix =

| PubChem = 5186

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL =

| ChemSpiderID = 4998

| C=18 | H=18 | N=2 | O=4

| smiles = C1=CC2=C3C(=C1)C(=O)N(C(=O)C3=CC=C2)CCCCCC(=O)NO

| StdInChI = 1S/C18H18N2O4/c21-15(19-24)10-2-1-3-11-20-17(22)13-8-4-6-12-7-5-9-14(16(12)13)18(20)23/h4-9,24H,1-3,10-11H2,(H,19,21)

| StdInChIKey = JTDYUFSDZATMKU-UHFFFAOYSA-N

}}

Scriptaid is a drug which acts as a histone deacetylase inhibitor, and was one of the first compounds discovered via high-throughput screening that acts at this target.{{cite journal | vauthors = Su GH, Sohn TA, Ryu B, Kern SE | title = A novel histone deacetylase inhibitor identified by high-throughput transcriptional screening of a compound library | journal = Cancer Research | volume = 60 | issue = 12 | pages = 3137–42 | date = June 2000 | pmid = 10866300 }} Scriptaid itself was never developed for medical applications, but led to the development of structurally related drugs such as vorinostat, which have been accepted into clinical use. Most early research using these compounds focused on their anti-cancer activity,{{cite journal | vauthors = Monneret C | title = Histone deacetylase inhibitors | journal = European Journal of Medicinal Chemistry | volume = 40 | issue = 1 | pages = 1–13 | date = January 2005 | pmid = 15642405 | doi = 10.1016/j.ejmech.2004.10.001 }} but more recent research has found scriptaid to be useful in other applications such as cloning and research into regulation of metabolism.{{cite journal | vauthors = Wang G, Jiang X, Pu H, Zhang W, An C, Hu X, Liou AK, Leak RK, Gao Y, Chen J | display-authors = 6 | title = Scriptaid, a novel histone deacetylase inhibitor, protects against traumatic brain injury via modulation of PTEN and AKT pathway : scriptaid protects against TBI via AKT | journal = Neurotherapeutics | volume = 10 | issue = 1 | pages = 124–42 | date = January 2013 | pmid = 23132328 | pmc = 3557358 | doi = 10.1007/s13311-012-0157-2 }}{{cite journal | vauthors = Zhu X, Nie J, Quan S, Xu H, Yang X, Lu Y, Lu K, Lu S | s2cid = 15676479 | display-authors = 6 | title = In vitro production of cloned and transgenically cloned embryos from Guangxi Huanjiang Xiang pig | journal = In Vitro Cellular & Developmental Biology. Animal | volume = 52 | issue = 2 | pages = 137–43 | date = February 2016 | pmid = 26559066 | doi = 10.1007/s11626-015-9957-0 }}{{cite journal | vauthors = Rissi VB, Glanzner WG, Mujica LK, Antoniazzi AQ, Gonçalves PB, Bordignon V | title = Effect of Cell Cycle Interactions and Inhibition of Histone Deacetylases on Development of Porcine Embryos Produced by Nuclear Transfer | journal = Cellular Reprogramming | volume = 18 | issue = 1 | pages = 8–16 | date = February 2016 | pmid = 27281695 | doi = 10.1089/cell.2015.0052 }}{{cite journal | vauthors = Gaur V, Connor T, Sanigorski A, Martin SD, Bruce CR, Henstridge DC, Bond ST, McEwen KA, Kerr-Bayles L, Ashton TD, Fleming C, Wu M, Pike Winer LS, Chen D, Hudson GM, Schwabe JW, Baar K, Febbraio MA, Gregorevic P, Pfeffer FM, Walder KR, Hargreaves M, McGee SL | display-authors = 6 | title = Disruption of the Class IIa HDAC Corepressor Complex Increases Energy Expenditure and Lipid Oxidation | journal = Cell Reports | volume = 16 | issue = 11 | pages = 2802–2810 | date = September 2016 | pmid = 27626651 | doi = 10.1016/j.celrep.2016.08.005 | doi-access = free | hdl = 10536/DRO/DU:30086375 | hdl-access = free }}