Login
Login

Seleninyl fluoride

{{Chembox

|ImageFile=SeOF2.svg

|ImageFile2=Seleninyl-fluoride-3D-balls.png

|OtherNames=selenium difluoride oxide

|Section1={{Chembox Identifiers

| CASNo=7783-43-9

| CASNo_Ref = {{Cascite|correct|CAS}}

| ChemSpiderID = 10329070

| PubChem = 23236009

| UNII = U8FGC2C7TN

| StdInChI=1S/F2OSe/c1-4(2)3

| StdInChIKey = CXZZMNPTKAXBFL-UHFFFAOYSA-N

| SMILES=O=[Se](F)F

}}

|Section2={{Chembox Properties

|Se=1|O=1|F=2

|Appearance=colourless fuming liquid{{cite book | last1=Holloway | first1=John H. | last2=Laycock | first2=David | title=Advances in Inorganic Chemistry | chapter=Preparations and Reactions of Inorganic Main-Group Oxide Fluorides | publisher=Elsevier | year=1983 | volume=27 | pages=157–195 | issn=0898-8838 | doi=10.1016/s0898-8838(08)60107-5| isbn=9780120236275 }}

|BoilingPtC=125

}}

|Section3={{Chembox Structure

|Dipole=3.18±0.02 D

}}

|Section8={{Chembox Related

|OtherAnions=selenium oxychloride
selenium oxybromide

|OtherCations=thionyl fluoride

|OtherCompounds=selenium dioxydifluoride

}}

}}

Seleninyl fluoride is an oxyfluoride of selenium with the chemical formula SeOF2.

Preparation

Seleninyl fluoride can be produced by the reaction of selenium oxychloride and potassium fluoride.{{cite journal | last1=Paetzold | first1=R. | last2=Aurich | first2=K. | title=Untersuchungen an Selen-Sauerstoff-Verbindungen. XIII. Bildung und Darstellung von SeOF2 und SeOCl2 | journal=Zeitschrift für anorganische und allgemeine Chemie | publisher=Wiley | volume=315 | issue=1–2 | year=1962 | issn=0044-2313 | doi=10.1002/zaac.19623150110 | pages=72–78 | language=de}}

:2 KF + SeOCl2 → 2 KCl + SeOF2

It can also be produced by the reaction of selenium tetrafluoride with water or selenium dioxide.{{cite journal | last1=Bowater | first1=I.C. | last2=Brown | first2=R.D. | last3=Burden | first3=F.R. | title=The microwave spectrum, structure, and dipole moment of seleninyl fluoride | journal=Journal of Molecular Spectroscopy | publisher=Elsevier BV | volume=23 | issue=3 | year=1967 | issn=0022-2852 | doi=10.1016/s0022-2852(67)80015-8 | pages=272–279| bibcode=1967JMoSp..23..272B }}

:SeF4 + H2O → SeOF2 + 2 HF

:SeF4 + SeO2 → 2 SeOF2

The reaction of selenium dioxide and sulfur tetrafluoride also produces seleninyl fluoride.{{cite book | last1=Seppelt | first1=Konrad | last2=Lentz | first2=Dieter | last3=Klöter | first3=Gerhard | last4=Schack | first4=Carl J. | title=Inorganic Syntheses | chapter=Selenium Tetrafluoride, Selenium Difluoride Oxide (Seleninyl Fluoride), and Xenon Bis[Pentafluorooxoselenate(VI)] | publisher=John Wiley & Sons, Inc. | publication-place=Hoboken, NJ, USA | date=2007-01-05 | pages=27–31 | issn=1934-4716 | doi=10.1002/9780470132555.ch9| isbn=9780470132555 }}

:SeO2 + SF4 → SeOF2 + SOF2

Reactions

Seleninyl fluoride reacts with xenon difluoride to form Xe(OSeF5)2.

:3 XeF2 + 2 SeOF2 → Xe(OSeF5)2 + 2 Xe

It reacts with fluorine gas and potassium fluoride to form pentafluoroselenium hypofluorite.{{cite journal|journal=Inorganic Chemistry|volume=9|issue=6|language=en|issn=0020-1669|date=1970|pages=1442–1445|doi=10.1021/ic50088a029|url=https://pubs.acs.org/doi/abs/10.1021/ic50088a029|title=Reactions of fluoroxypentafluoroselenium|accessdate=2022-02-02|author=James Everett Smith, George H. Cady}}{{cite journal | last=Seppelt | first=Konrad | title=Halogenderivate der Pentafluoroorthoselensäure | journal=Chemische Berichte | publisher=Wiley | volume=106 | issue=1 | year=1973 | issn=0009-2940 | doi=10.1002/cber.19731060119 | pages=157–164}}

:SeOF2 + KF → K+[SeOF3]− —F2→ K+[SeOF5]− —F2→ KF + SeOF6

Uses

Seleninyl fluoride have been used as specialty solvents.{{cite book |title=Inorganic chemistry |first=James E. |last=House |publisher=Academic Press |year=2008 |isbn=978-0-12-356786-4 |page=524}}

References

{{reflist}}

{{selenium compounds}}

Category:Selenium(IV) compounds

Category:Oxyfluorides