Selenium tetraazide
{{Chembox
| ImageFile =
| ImageSize =
| ImageAlt =
| IUPACName = Selenium(IV) tetraazide
| OtherNames = Selenium tetraazide
| Section1 = {{Chembox Identifiers
| CASNo =1003019-88-2
| CASNo_Ref ={{cascite|correct|CAS}}
| ChemSpiderID =
| PubChem = 139263047
| StdInChI = 1S/N12Se/c1-5-9-13(10-6-2,11-7-3)12-8-4
| StdInChIKey = RAHBAOGFMBUQBX-UHFFFAOYSA-N
| SMILES = [N-]=[N+]=N[Se](N=[N+]=[N-])(N=[N+]=[N-])N=[N+]=[N-]
}}
| Section2 = {{Chembox Properties
| Formula = {{chem2|Se(N3)4}}
| MolarMass = 247.05 g/mol
| Appearance = Yellow solid
| Density =
| MeltingPtC =
| MeltingPt_notes =
| BoilingPt =
| Solubility =
}}
}}
Selenium tetraazide is an inorganic chemical compound with the formula {{chem2|Se(N3)4}}. It is a highly sensitive explosive, and has been prepared directly from selenium tetrafluoride and trimethylsilyl azide.
Properties
Selenium tetraazide is a yellow solid which precipitates frequently due to its low solubility. The compound is very susceptible to combustion even at low temperatures, and was only found to be stable at -50 degrees Celsius.{{cite journal |last1=Klapötke |first1=Thomas M. |last2=Krumm |first2=Burkhard |last3=Scherr |first3=Matthias |last4=Haiges |first4=Ralf |last5=Christe |first5=Karl O. |title=The Binary Selenium(IV) Azides Se(N3)4, [Se(N3)5]−, and [Se(N3)6]2− |journal=Angewandte Chemie |date=8 November 2007 |volume=46 |issue=45 |pages=8686–8690 |doi=10.1002/anie.200702758 |pmid=17935101 |url=https://onlinelibrary.wiley.com/doi/10.1002/anie.200702758 |access-date=3 November 2023}}