Selligueain A

{{chembox

| Watchedfields = changed

| verifiedrevid = 449643761

| Name = Selligueain A

| Reference =

| ImageFile = Selligueain A.svg

| ImageName = Chemical structure of selligueain A

| ImageSize = 200px

| IUPACName =

| OtherNames = Epiafzelechin-(4β-8,2β-0-7)-epiafzelechin-(4β-8)-afzelechin

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 152378-18-2

| CASNoOther =

| PubChem = 132944

| SMILES = C1C(C(OC2=C1C(=CC(=C2C3C(C(OC4=C5C6C(C(OC7=CC(=CC(=C67)O)O)(OC5=CC(=C34)O)C8=CC=C(C=C8)O)O)C9=CC=C(C=C9)O)O)O)O)C1=CC=C(C=C1)O)O

}}

|Section2={{Chembox Properties

| Formula = C₄₅H₃₆O₁₅

| MolarMass = 816.75 g/mol

| Appearance =

| Density =

| MeltingPtC =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Selligueain A is an A type proanthocyanidin trimer of the propelargonidin type.

It can be extracted from the rhizome of the fern Selliguea feei collected in Indonesia.{{cite journal| pmid=8254348 | volume=56 | title=Selligueain A, a novel highly sweet proanthocyanidin from the rhizomes of Selliguea feei | year=1993 | journal=J Nat Prod | pages=1532–8 | last1 = Baek | first1 = NI | last2 = Chung | first2 = MS | last3 = Shamon | first3 = L | last4 = Kardono | first4 = LB | last5 = Tsauri | first5 = S | last6 = Padmawinata | first6 = K | last7 = Pezzuto | first7 = JM | last8 = Soejarto | first8 = DD | last9 = Kinghorn | first9 = AD | issue=9 | doi = 10.1021/np50099a011}}

It has sweetener properties with relative sweetness of 35 times as compared to the intensity of a 2% w/v aqueous sucrose solution.