Sobetirome
{{Short description|Chemical compound}}
{{Infobox drug
| drug_name =
| INN =
| type =
| image = Sobetirome v2.svg
| alt =
| caption =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_category=
| routes_of_administration = Oral
| ATCvet =
| ATC_prefix =
| ATC_suffix =
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US =
| legal_US_comment =
| legal_EU =
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status = Investigational
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action=
| excretion =
| synonyms = GC-1
| CAS_number = 211110-63-3
| ChEBI = 79988
| ChEMBL = 107400
| ChemSpiderID = 8037944
| IUPHAR_ligand = 2639
| KEGG = D09381
| PubChem = 9862248
| UNII = XQ31741E9Q
| DrugBank = DB07425
| StdInChI=1S/C20H24O4/c1-12(2)17-9-15(5-6-19(17)21)10-18-13(3)7-16(8-14(18)4)24-11-20(22)23/h5-9,12,21H,10-11H2,1-4H3,(H,22,23)
| StdInChIKey = QNAZTOHXCZPOSA-UHFFFAOYSA-N
| SMILES = CC1=CC(=CC(=C1CC2=CC(=C(C=C2)O)C(C)C)C)OCC(=O)O
| IUPAC_name = 2-[4-[(4-Hydroxy-3-propan-2-ylphenyl)methyl]-3,5-dimethylphenoxy]acetic acid
| C=20 | H=24 | O=4
}}
Sobetirome (GC-1) is a thyromimetic drug that binds to the thyroid hormone receptor TRβ1 preferentially compared to TRα1. It has been investigated for the treatment of dyslipidemia, obesity,{{cite journal |last1=Lammel Lindemann |first1=Jan |last2=Webb |first2=Paul |title=Sobetirome: the past, present and questions about the future |journal=Expert Opinion on Therapeutic Targets |date=2016 |volume=20 |issue=2 |pages=145–149 |doi=10.1517/14728222.2016.1090429 |pmid=26565124 |issn=1744-7631|doi-access=free }} Pitt–Hopkins syndrome,{{cite journal |last1=Bohlen |first1=Joseph F |last2=Cleary |first2=Colin M |last3=Das |first3=Debamitra |last4=Sripathy |first4=Srinidhi Rao |last5=Sadowski |first5=Norah |last6=Shim |first6=Gina |last7=Kenney |first7=Rakaia F |last8=Buchler |first8=Ingrid P |last9=Banerji |first9=Tapasree |last10=Scanlan |first10=Thomas S |last11=Mulkey |first11=Daniel K |last12=Maher |first12=Brady J |title=Promyelinating drugs promote functional recovery in an autism spectrum disorder mouse model of Pitt–Hopkins syndrome |journal=Brain |date=1 August 2023 |volume=146 |issue=8 |pages=3331–3346 |doi=10.1093/brain/awad057 |url=https://academic.oup.com/brain/article/146/8/3331/7116255|doi-access=free |pmid=37068912 |pmc=10393406 }} cholestatic liver disease,{{cite journal |last1=Kosar |first1=Karis |last2=Cornuet |first2=Pamela |last3=Singh |first3=Sucha |last4=Liu |first4=Silvia |last5=Nejak-Bowen |first5=Kari |title=The Thyromimetic Sobetirome (GC-1) Alters Bile Acid Metabolism in a Mouse Model of Hepatic Cholestasis |journal=The American Journal of Pathology |date=May 2020 |volume=190 |issue=5 |pages=1006–1017 |doi=10.1016/j.ajpath.2020.01.015 |pmid=32205094 |pmc=7221298 |issn=0002-9440}} multiple sclerosis,{{cite book |last1=Shah |first1=Kamal |last2=Chauhan |first2=Durgesh Nandini |last3=Chauhan |first3=Nagendra Singh |last4=Mishra |first4=Pradeep |title=Recent Advancement in Prodrugs |date=13 May 2020 |publisher=CRC Press |isbn=978-1-000-05799-7 |url=https://books.google.com/books?id=nWbnDwAAQBAJ&pg=SA4-PA80 |language=en}} bleomycin-induced lung fibrosis,{{cite journal |last1=Matralis |first1=Alexios |last2=Karampitsakos |first2=Theodoros |last3=Papaioannou |first3=Ourania |last4=Katsaras |first4=Matthaios |last5=Sampsonas |first5=Fotios |last6=Bouros |first6=Demosthenes |last7=Aidinis |first7=Vassilis |last8=Tzouvelekis |first8=Argyrios |title=Biosynthesis and implementation of Thyroid Receptor beta (TRß) agonists (thyromimetics) for the treatment of pulmonary fibrosis |journal=European Respiratory Journal |date=5 September 2021 |volume=58 |issue=suppl 65 |pages=OA4334 |doi=10.1183/13993003.congress-2021.OA4334 |s2cid=244680799 |url=https://erj.ersjournals.com/content/58/suppl_65/OA4334.abstract |language=en |issn=0903-1936|url-access=subscription }} and COVID-19 caused ARDS.{{cite web |last1=Hartley |first1=Pamela |title=$100,000 Gift Speeds Exploration of Sobetirome as COVID-19 Treatment |url=https://medicine.yale.edu/news-article/100000-gift-speeds-exploration-of-sobetirome-as-covid-19-treatment/ |website=medicine.yale.edu |access-date=15 September 2023 |language=en}} It was designated as an orphan drug by the FDA for the treatment of X-linked adrenoleukodystrophy.{{cite web |title=Search Orphan Drug Designations and Approvals |url=https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=334811 |archive-url=https://web.archive.org/web/20250415040737/https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=334811 |url-status=dead |archive-date=April 15, 2025 |website=www.accessdata.fda.gov |access-date=15 September 2023}}