Sodium ferric gluconate complex
{{Use dmy dates|date=April 2020}}
{{Infobox drug
| image =
| width =
| alt =
| caption =
| pronounce =
| tradename = Ferrlecit
| Drugs.com = {{Drugs.com|monograph|sodium-ferric-gluconate}}
| MedlinePlus = a614030
| licence_CA =
| licence_EU =
| DailyMedID = Ferrlecit
| licence_US =
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_US = B
| pregnancy_US_comment = {{cite web | title=Sodium ferric gluconate complex Use During Pregnancy | website=Drugs.com | date=16 December 2019 | url=https://www.drugs.com/pregnancy/sodium-ferric-gluconate-complex.html | access-date=2 April 2020}}
| pregnancy_category=
| dependency_liability =
| addiction_liability =
| routes_of_administration = Intravenous (IV)
| class =
| ATCvet =
| ATC_prefix = B03
| ATC_suffix = AC
| ATC_supplemental =
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US = Rx-only
| legal_US_comment =
| legal_UN =
| legal_UN_comment =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 34089-81-1
| CAS_supplemental =
| PubChem = 76968835
| PubChemSubstance =
| IUPHAR_ligand =
| DrugBank_Ref =
| DrugBank = DB09517
| ChemSpiderID_Ref =
| ChemSpiderID = 34989638
| UNII_Ref =
| UNII = CC9149U2QX
| KEGG_Ref =
| KEGG = D05859
| ChEBI_Ref =
| ChEBI =
| ChEMBL_Ref =
| ChEMBL =
| NIAID_ChemDB =
| PDB_ligand =
| synonyms =
| IUPAC_name =
| C = 66 | H = 121 | Fe = 2 | Na = 1 | O = 65
| molecular_weight =
| SMILES = O[C@H]([C@@H](O)C(O[Na])=O)[C@H](O)[C@H](O)CO.O[C@H]([C@@H](O)C(O1)=O)[C@H](O)[C@H](O)CO.[Fe]1(OC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)OC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO
| Jmol =
| StdInChI = 1S/5C12H22O11.C6H12O7.2Fe.Na.3O/c5*13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12;7-1-2(8)3(9)4(10)5(11)6(12)13;;;;;;/h5*4-11,13-20H,1-3H2;2-5,7-11H,1H2,(H,12,13);;;;;;/q;;;;;;2*+3;+1;3*-2/p-1/t5*4-,5-,6-,7-,8+,9-,10+,11-,12+;2-,3-,4+,5-;;;;;;/m111111....../s1
| StdInChI_comment =
| StdInChIKey = MQBDAEHWGRMADS-XNHLMZCASA-M
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
Sodium ferric gluconate complex, sold under the brand name Ferrlecit, is an intravenously administered iron medication for the treatment of iron deficiency anemia in adults and in children aged six years and older with chronic kidney disease receiving hemodialysis who are receiving supplemental epoetin therapy.{{cite web | title=Ferrlecit- sodium ferric gluconate complex injection | website=DailyMed | date=25 September 2019 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=1fe028ff-42ac-4329-b1a5-a9dadfcb79f6 | access-date=2 April 2020}} The macromolecule has an apparent molecular weight of 289,000–440,000 Dalton.{{cite web |url=http://www.drugbank.ca/drugs/DB09517 |title= Sodium ferric gluconate complex|website=www.drugbank.ca |access-date=21 June 2020}}{{title missing|date=September 2022}}{{cite journal | vauthors = Fishbane S, Wagner J | title = Sodium ferric gluconate complex in the treatment of iron deficiency for patients on dialysis | journal = American Journal of Kidney Diseases | volume = 37 | issue = 5 | pages = 879–83 | date = May 2001 | pmid = 11325667 | doi = 10.1016/s0272-6386(05)80001-0 }}
The most common side effects in adults are nausea, vomiting and/or diarrhea, injection site reaction, hypotension, cramps, hypertension, dizziness, dyspnea, chest pain, leg cramps, and pain. In children the most common side effects are hypotension, headache, hypertension, tachycardia and vomiting.
References
{{reflist}}
{{Antianemic preparations}}
{{Portal bar | Medicine}}
Category:Antianemic preparations
{{blood-drug-stub}}