Sodium persulfate

{{chembox

| Watchedfields = changed

| verifiedrevid = 464402995

| Name = Sodium persulfate

| ImageFile = Natriumpersulfat.PNG

| ImageName = Two sodium cations and one peroxodisulphate anion

| ImageFile1 = Sodium-persulfate-xtal-2006-3D-balls.png

| ImageName1 = Ball-and-stick model of the crystal structure

| ImageFile2 = Peroxodisíran sodný.JPG

| ImageName2 = Sodium persulfate as a white powder

| OtherNames = Sodium peroxodisulfate
Sodium peroxodisulphate
Sodium peroxydisulfate
Sodium peroxydisulphate

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 56406

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 502764

| InChI = 1/2Na.H2O8S2/c;;1-9(2,3)7-8-10(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2

| InChIKey = CHQMHPLRPQMAMX-NUQVWONBAA

| SMILES = [Na+].[Na+].O=S(=O)([O-])OOS([O-])(=O)=O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/2Na.H2O8S2/c;;1-9(2,3)7-8-10(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CHQMHPLRPQMAMX-UHFFFAOYSA-L

| CASNo = 7775-27-1

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = J49FYF16JE

| PubChem = 62655

| EINECS = 231-892-1

| UNNumber = 1505

| RTECS = SE0525000

}}

|Section2={{Chembox Properties

| Formula = Na2S2O8

| MolarMass = 238.10 g/mol

| Appearance = White powder

| Density = 2.601 g/cm3{{cite journal |doi=10.1107/S1600536806004302|title=Sodium peroxodisulfate |year=2006 |last1=Allan |first1=David R. |journal=Acta Crystallographica Section E |volume=62 |issue=3 |pages=i44–i46 |doi-access=free }}

| Solubility = 55.6 g/100{{nnbsp}}ml (20 °C)

| MeltingPtC = 180

| MeltingPt_notes = decomposes

}}

|Section7={{Chembox Hazards

| ExternalSDS = [http://www.inchem.org/documents/icsc/icsc/eics1136.htm ICSC 1136]

| GHSPictograms = {{GHS03}} {{GHS07}} {{GHS08}}

| GHSSignalWord = DANGER

| HPhrases = {{H-phrases|272|302|315|317|319|334|335|371}}

| PPhrases = {{P-phrases|220|261|280|305+351+338|342+311}}

| NFPA-H = 2

| NFPA-F = 0

| NFPA-R = 1

| NFPA-S = OX

| FlashPt = Non-flammable

| PEL =

}}

|Section8={{Chembox Related

| OtherAnions = Sodium dithionite
Sodium sulfite
Sodium sulfate

| OtherCations = Potassium persulfate

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Sodium persulfate is the inorganic compound with the formula Na2S2O8. It is the sodium salt of peroxydisulfuric acid, H2S2O8, an oxidizing agent. It is a white solid that dissolves in water. It is almost non-hygroscopic and has good shelf-life.

Production

The salt is prepared by the electrolytic oxidation of sodium bisulfate:

:{{Chem2 | 2 NaHSO4 -> Na2S2O8 + H2 }}

Oxidation is conducted at a platinum anode.Pietzsch, A.; Adolph, G. J. Chem. Technol. Biotechnol. 1911, 30, 85. In this way about 165,000 tons were produced in 2005.{{Ullmann | title = Peroxo Compounds, Inorganic | author = Harald Jakob, Stefan Leininger, Thomas Lehmann, Sylvia Jacobi, Sven Gutewort | doi = 10.1002/14356007.a19_177.pub2}}

The standard redox potential of sodium persulfate into hydrogen sulfate is 2.1 V, which is higher than that of hydrogen peroxide (1.8 V) but lower than ozone (2.2 V).Block, Philip A., Richard A. Brown, and David Robinson. "Novel activation technologies for sodium persulfate in-situ chemical oxidation." Proceedings of the Fourth International Conference on the remediation of chlorinated and recalcitrant compounds. 2004. The sulfate radical formed in situ has a standard electrode potential of 2.7 V.

However, there are a few drawbacks in utilizing platinum anodes to produce the salts; the manufacturing process is inefficient due to oxygen evolution and the product could contain contaminants coming from platinum corrosion (mainly due to extremely oxidizing nature of the sulfate radical). Thus, boron-doped diamond electrodes have been proposed as alternatives to the conventional platinum electrodes.{{cite journal|last1=Shafiee|first1=Saiful Arifin|last2=Aarons|first2=Jolyon|last3=Hairul Hisham|first3=Hamzah|year=2018|title=Electroreduction of Peroxodisulfate: A Review of a Complicated Reaction|url=http://m.jes.ecsdl.org/content/165/13/H785.abstract?sid=3ddef67b-7f3b-49fa-93a7-c6eee812bfe4|journal=Journal of the Electrochemical Society|volume=165|issue=13|pages=H785–H798|doi=10.1149/2.1161811jes|s2cid=106396614 |doi-access=free}}

Structure

The sodium and potassium salts adopt very similar structures in the solid state, according to X-ray crystallography. In the sodium salt, the O-O distance is 1.476{{nbsp}}Å. The sulfate groups are tetrahedral, with three short S-O distances near 1.44 and one long S-O bond at 1.64{{nbsp}}Å.

Applications

It is mainly used as a radical initiator for emulsion polymerization reactions for styrene based polymers such as acrylonitrile butadiene styrene. It is also applicable for accelerated curing of low formaldehyde adhesives.

=Other uses=

It is a bleach, both standalone (particularly in hair cosmetics) and as a detergent component. It is a replacement for ammonium persulfate in etching mixtures for zinc and printed circuit boards, and is used for pickling of copper and some other metals.{{Citation needed|date=May 2025}}

It is also used as a soil conditioner and for soil and groundwater remediation{{cite journal|title= Chemistry of persulfates in water and wastewater treatment: A review|journal = Chemical Engineering Journal |volume = 330 |pages = 44–62 |doi = 10.1016/j.cej.2017.07.132|year = 2017 |last1 = Wacławek |first1 = Stanisław |last2 = Lutze |first2 = Holger V. |last3 = Grübel |first3 = Klaudiusz |last4 = Padil |first4 = Vinod V.T. |last5 = Černík |first5 = Miroslav |last6 = Dionysiou |first6 = Dionysios.D. }} and in manufacture of dyestuffs, modification of starch, bleach activator, desizing agent for oxidative desizing, etc.

=Organic chemistry=

Sodium persulfate is a specialized oxidizing agent in chemistry, classically in the Elbs persulfate oxidation and the Boyland–Sims oxidation reactions. It is also used in radical reactions; for example in a synthesis of diapocynin from apocynin where iron(II) sulfate is the radical initiator.{{cite journal | last1 = Luchtefeld | first1 = Ron | last2 = Dasari | first2 = Mina S. | last3 = Richards | first3 = Kristy M. | last4 = Alt | first4 = Mikaela L. | last5 = Crawford | first5 = Clark F. P. | last6 = Schleiden | first6 = Amanda | last7 = Ingram | first7 = Jai | last8 = Hamidou | first8 = Abdel Aziz Amadou | last9 = Williams | first9 = Angela | last10 = Chernovitz | first10 = Patricia A. | last11 = Sun | first11 = Grace Y. | last12 = Luo | first12 = Rensheng | last13 = Smith | first13 = Robert E. | doi = 10.1021/ed085p411 | title = Synthesis of Diapocynin | year = 2008 | pages = 411 | volume = 85 | journal = J. Chem. Educ. | issue = 3| display-authors = 8 | bibcode = 2008JChEd..85..411D }}

:Diapocynin Synthesis

Safety

The salt is an oxidizer and forms combustible mixtures with organic materials such as paper.

References

{{reflist}}

{{Sodium compounds}}

{{Persulfates}}

Category:Persulfates

Category:Sodium compounds

Category:Oxidizing agents