Sorbinil

{{chembox

| ImageFile = Sorbinil.svg

| ImageSize = 150px

| ImageAlt = Structural formula of sorbinil

| ImageFile1 = Sorbinil 3D ball.png

| ImageSize1 = 160

| ImageAlt1 = Ball-and-stick model of the sorbinil molecule

| PIN = (4S)-6-Fluoro-2,3-dihydrospiro[[1]benzopyran-4,4′-imidazolidine]-2,5-dione

| OtherNames = (S)-6-Fluorospiro(chroman-4,4'-imidazolidine)-2',5'-dione; CP 45634

| Section1 = {{Chembox Identifiers

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = G4186B906P

| IUPHAR_ligand = 7415

| CASNo = 68367-52-2

| PubChem = 337359

| KEGG = D05893

| ChEMBL = 7681

| ChemSpiderID = 298991

| SMILES = Fc3ccc2OCC[C@@]1(C(=O)NC(=O)N1)c2c3

| InChI = InChI=1S/C11H9FN2O3/c12-6-1-2-8-7(5-6)11(3-4-17-8)9(15)13-10(16)14-11/h1-2,5H,3-4H2,(H2,13,14,15,16)/t11-/m0/s1

}}

| Section2 = {{Chembox Properties

| Properties_ref = [http://www.sigmaaldrich.com/catalog/product/sigma/s7701?lang=en®ion=US Sorbinil] at Sigma-Aldrich

| C=11 | H=9 | F=1 | N=2 | O=3

| Appearance = White to off-white powder

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}{{cite web|title=International Nonproprietary Names for Pharmaceutical Substances (INN). Recommended International Nonproprietary names (Rec. INN): List 25|url=https://www.who.int/medicines/publications/druginformation/innlists/RL25.pdf|publisher=World Health Organization|accessdate=11 November 2016|date=1985}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Sorbinil (INN) is an aldose reductase inhibitor being investigated for treatment of diabetic complications including neuropathy and retinopathy.{{Cite journal | pmid = 21129963 | year = 2011 | last1 = MacCari | first1 = R | last2 = Del Corso | first2 = A | last3 = Giglio | first3 = M | last4 = Moschini | first4 = R | last5 = Mura | first5 = U | last6 = Ottanà | first6 = R | title = In vitro evaluation of 5-arylidene-2-thioxo-4-thiazolidinones active as aldose reductase inhibitors | volume = 21 | issue = 1 | pages = 200–3 | doi = 10.1016/j.bmcl.2010.11.041 | journal = Bioorganic & Medicinal Chemistry Letters}} Aldose reductase is an enzyme present in lens and brain that removes excess glucose by converting it to sorbitol. Sorbitol accumulation can lead to the development of cataracts in the lens and neuropathy in peripheral nerves. Sorbinil has been shown to inhibit aldose reductase in human brain{{cite journal|last1=O'Brien MM|title=Inhibition of human brain aldose reductase and hexonate dehydrogenase by alrestatin and sorbinil|journal=J Neurochem|date=1982|volume=39|issue=3 |pages=810–4|pmid=6808090|display-authors=etal|doi=10.1111/j.1471-4159.1982.tb07964.x|s2cid=22368580 }} and placenta{{cite journal|last1=Kinoshita JH|title=Aldose reductase in diabetic complications of the eye|journal=Metabolism|date=1979|volume=28|issue=suppl 1|pages=462–9|pmid=45423|display-authors=etal|doi=10.1016/0026-0495(79)90057-x}} and calf{{cite journal|last1=Peterson MJ|title=CP45,634: A novel aldose reductase inhibitor that inhibits polyol pathway activity in diabetic and galactosemic rats.|journal=Metabolism|date=1979|volume=28|issue=Suppl 1|pages=456–61|pmid=122297|display-authors=etal|doi=10.1016/0026-0495(79)90056-8}} and rat lens. Sorbinil reduced sorbitol accumulation in rat lens and sciatic nerve of diabetic rats orally administered 0.25 mg/kg sorbinil.