Sorbose

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 450955931

| ImageFileL1 = L-sorbose_Fischer.png

| ImageSizeL1 = 75px

| ImageFileR1 = sorbose.png

| ImageSizeR1 = 150px

| IUPACName = L-xylo-Hex-2-ulose

| OtherNames = Sorbinose
L-xylo-Hexulose

| SystematicName = (3S,4R,5S)-1,3,4,5,6-Pentahydroxyhexan-2-one

| Section1 = {{Chembox Identifiers

|CASNo_Ref = {{cascite|correct|CAS}}

|CASNo=87-79-6

|UNII_Ref = {{fdacite|correct|FDA}}

|UNII = NV2001607Y

|PubChem=6904

|ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

|ChemSpiderID = 6638

|InChI = 1/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6+/m0/s1

|InChIKey = BJHIKXHVCXFQLS-OTWZMJIIBK

|StdInChI_Ref = {{stdinchicite|changed|chemspider}}

|StdInChI = 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6+/m0/s1

|StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

|StdInChIKey = BJHIKXHVCXFQLS-OTWZMJIISA-N

|SMILES=C([C@@H]([C@H]([C@@H](C(=O)CO)O)O)O)O

}}

| Section2 = {{Chembox Properties

|Properties_ref = Merck Index, 12th Edition, 8874

|C=6 | H=12 | O=6

|Appearance=white solid

|Density=1.65 g/cm³ (15 °C)

|MeltingPtC=165

|Solubility=Highly Soluble

}}

}}

Sorbose is a ketose belonging to the group of sugars known as monosaccharides. It has a sweetness that is equivalent to sucrose (table sugar). The commercial production of vitamin C (ascorbic acid) often begins with sorbose. L-Sorbose is the configuration of the naturally occurring sugar. It can be prepared from inexpensive O-benzylglucose.