Spathulenol

{{Chembox

| ImageFile = Spathulenol.svg

| ImageSize = 200px

| IUPACName = 6β,11-Cyclo-4α,5β-guai-10(14)-en-4-ol

| SystematicName = (1aR,4aR,7S,7aR,7bR)-1,1,7-Trimethyl-4-methylidenedecahydro-1H-cyclopropa[e]azulen-7-ol

| OtherNames = Spatulenol

| Section1 = {{Chembox Identifiers

| CASNo = 6750-60-3

| PubChem = 92231

| UNII = 7XV9L96SJJ

| SMILES = C[C@@]1(CC[C@@H]2[C@@H]1[C@H]3[C@H](C3(C)C)CCC2=C)O

}}

| Section2 = {{Chembox Properties

| C=15|H=24|O=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Spathulenol is a tricyclic sesquiterpene alcohol which has a basic skeleton similar to the azulenes. It occurs in oregano among other plants.

History and occurrence

A volatile oil was extracted from mugwort distillery (Artemisia vulgaris) and tarragon (Artemisia dracunculus), from which the sesquiterpene alcohol spathulenol was isolated for the first time in 1975 as a colorless, viscous compound with an earth-aromatic odor and bitter-spicy taste.{{cite journal | doi = 10.1002/ardp.19763090605

| pmid = 962558

| title = Neue Substanzen aus ätherischen Ölen verschiedener Artemisia-Species, 1. Mitt.: Spathulenol, ein azulenogener Sesquiterpenalkohol

| journal = Archiv der Pharmazie

| volume = 309

| issue = 6

| pages = 458–466

| year = 1976

| last1 = Juell

| first1 = S. Monrad-Krohn

| last2 = Hansen

| first2 = Rudolf

| last3 = Jork

| first3 = Hellmut

| s2cid = 95354157

}}

References

{{Reflist}}

{{biochemistry-stub}}

Category:Sesquiterpenes

Category:Herbal distillates