Spiramide

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 443306099

| IUPAC_name = 8-[3-(4-Fluorophenoxy)propyl]-1-phenyl-1,3,8-triazaspiro[4,5]decan-4-one

| image = Spiramide.svg

| width = 250px

| tradename =

| routes_of_administration =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 510-74-7

| ATC_prefix = none

| PubChem = 68186

| IUPHAR_ligand = 175

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID = 61493

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 64207

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 471LF4O004

| C=22 | H=27 | F=1 | N=3 | O=2

| smiles = c2cc(F)ccc2OCCCN3CCC1(CC3)N(CNC1=O)c4ccccc4

| StdInChI = 1S/C22H26FN3O2/c23-18-7-9-20(10-8-18)28-16-4-13-25-14-11-22(12-15-25)21(27)24-17-26(22)19-5-2-1-3-6-19/h1-3,5-10H,4,11-17H2,(H,24,27)

| StdInChIKey = FJUKDAZEABGEIH-UHFFFAOYSA-N

}}

Spiramide (developmental code name AMI-193) is an experimental antipsychotic that acts as a selective 5-HT_2A, 5-HT_1A, and D₂ receptor antagonist. It has negligible affinity for the 5-HT_2C receptor.{{cite journal |vauthors=Czoty PW, Howell LL |title=Behavioral effects of AMI-193, a 5-HT(2A)- and dopamine D(2)-receptor antagonist, in the squirrel monkey |journal=Pharmacology Biochemistry and Behavior |volume=67 |issue=2 |pages=257–64 |date=October 2000 |pmid=11124389 |doi= 10.1016/S0091-3057(00)00321-X|s2cid=36132685 }}{{cite journal |vauthors=Luparini MR, Garrone B, Pazzagli M, Pinza M, Pepeu G |title=A cortical GABA-5HT interaction in the mechanism of action of the antidepressant trazodone |journal=Progress in Neuro-psychopharmacology & Biological Psychiatry |volume=28 |issue=7 |pages=1117–27 |date=November 2004 |pmid=15610924 |doi=10.1016/j.pnpbp.2004.05.046 |s2cid=24076522 |url=https://zenodo.org/record/853060}}{{cite journal |vauthors=Hamada K, Yoshida M, Isayama H, Yagi Y, Kanazashi S, Kashihara Y, Takeuchi K, Yamaguchi I |title=Possible involvement of endogenous 5-HT in aggravation of cerulein-induced acute pancreatitis in mice |journal=Journal of Pharmacological Sciences |volume=105 |issue=3 |pages=240–50 |date=November 2007 |pmid=17965538 |doi= 10.1254/jphs.FP0071049|doi-access=free }}