Stepronin

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 447817179

| IUPAC_name = N-{2-[(2-thienylcarbonyl)thio]propanoyl}glycine

| image = Stepronin.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 72324-18-6

| ATC_prefix = R05

| ATC_suffix = CB11

| PubChem = 54120

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01423

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 48889

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 0NOY894QRB

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07381

| C=10 | H=11 | N=1 | O=4 | S=2

| smiles = CC(C(=O)NCC(=O)O)SC(=O)C1=CC=CS1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H11NO4S2/c1-6(9(14)11-5-8(12)13)17-10(15)7-3-2-4-16-7/h2-4,6H,5H2,1H3,(H,11,14)(H,12,13)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = JNYSEDHQJCOWQU-UHFFFAOYSA-N

}}

Stepronin is a mucolytic{{cite journal | vauthors = Olivieri D, Bernareggi V, Quitadamo M | title = [Effect of lysine stepronin salts on mucociliary clearance] | journal = Archivio Monaldi per la Tisiologia e le Malattie dell'apparato Respiratorio | volume = 40 | issue = 5–6 | pages = 211–7 | year = 1985 | pmid = 3843171 }} and expectorant.{{cite journal | vauthors = Yamada K, Satoh M, Shimura S, Sasaki T, Takishima T, Shirato K | title = An expectorant, stepronin, reduces airway secretion in vitro | journal = Respiration; International Review of Thoracic Diseases | volume = 61 | issue = 1 | pages = 42–7 | year = 1994 | pmid = 8177972 | doi = 10.1159/000196302 }}