Strictinin

{{Chembox

| ImageFile = Strictinin.svg

| ImageSize = 200px

| IUPACName = β-D-Glucopyranose 4,6-(4,4′,5,5′,6,6′-hexahydroxy[1,1′-biphenyl]-2,2′-dicarboxylate) 1-(3,4,5-trihydroxybenzoate)

| SystematicName = (11aR,13S,14R,15R,15aS)-2,3,4,5,6,7,14,15-Octahydroxy-9,17-dioxo-9,11,11a,13,14,15,15a,17-octahydrodibenzo[g,i]pyrano[3,2-b][1,5]dioxacycloundecin-13-yl 3,4,5-trihydroxybenzoate

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 517-46-4

| PubChem = 73330

| ChemSpiderID = 66059

| SMILES = C1[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)O

| InChI = 1/C27H22O18/c28-9-1-6(2-10(29)16(9)32)24(39)45-27-22(38)21(37)23-13(43-27)5-42-25(40)7-3-11(30)17(33)19(35)14(7)15-8(26(41)44-23)4-12(31)18(34)20(15)36/h1-4,13,21-23,27-38H,5H2/t13-,21-,22-,23-,27+/m1/s1

| InChIKey = FYIJLTSMNXUNLT-CXQFPWCTBJ

| StdInChI = 1S/C27H22O18/c28-9-1-6(2-10(29)16(9)32)24(39)45-27-22(38)21(37)23-13(43-27)5-42-25(40)7-3-11(30)17(33)19(35)14(7)15-8(26(41)44-23)4-12(31)18(34)20(15)36/h1-4,13,21-23,27-38H,5H2/t13-,21-,22-,23-,27+/m1/s1

| StdInChIKey = FYIJLTSMNXUNLT-CXQFPWCTSA-N

}}

|Section2={{Chembox Properties

| C=27 | H=22 | O=18

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Strictinin is a bioactive chemical of the ellagitannin family of hydrolyzable tannins. This compound shows activity against influenza virus.{{cite journal | pmid= 20615432 | title = Antiviral effect of strictinin on influenza virus replication | doi=10.1016/j.antiviral.2010.06.008 | volume=88 | issue=1 | date=October 2010 | journal=Antiviral Res. | pages=10–8| last1 = Saha | first1 = Repon Kumer | last2 = Takahashi | first2 = Tadanobu | last3 = Kurebayashi | first3 = Yuuki | last4 = Fukushima | first4 = Keijo | last5 = Minami | first5 = Akira | last6 = Kinbara | first6 = Noriaki | last7 = Ichitani | first7 = Masaki | last8 = Sagesaka | first8 = Yuko M. | last9 = Suzuki | first9 = Takashi }}

References