Strontium chlorate

{{chembox

| verifiedrevid =

| Name = Strontium chlorate

| ImageFile =

| ImageSize =

| ImageName =

| OtherNames =

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref =

| ChemSpiderID = 23043

| InChI = 1S/2ClHO3.Sr/c2*2-1(3)4;/h2*(H,2,3,4);/q;;+2/p-2

| InChIKey = FRTABACCYANHFP-UHFFFAOYSA-L

| SMILES = [O-]Cl(=O)=O.[O-]Cl(=O)=O.[Sr+2]

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI =

| StdInChIKey_Ref =

| StdInChIKey =

| CASNo = 7791-10-8

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = XG48A4P4FB

| PubChem = 24641

| RTECS =

| EINECS = 232-239-3

}}

|Section2={{Chembox Properties

| Formula = Sr(ClO₃)₂

| Appearance = colorless or white crystals

| Odor =

| MolarMass = 254.522 g/mol

| Density = 3.15 g/cm³

| Solubility = 174.9 g/100 mL (18 °C)

| SolubleOther = soluble in dilute alcohol
insoluble in absolute alcohol

| MeltingPtC = 120

| MeltingPt_notes = (decomposes)

| BoilingPt =

| RefractIndex = 1.516

| MagSus = −73.0·10⁻⁶ cm³/mol

}}

|Section3={{Chembox Structure

| CrystalStruct = rhombic

}}

|Section7={{Chembox Hazards

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

}}

|Section8={{Chembox Related

| OtherCations = Magnesium chlorate
Barium chlorate

}}

}}

Strontium chlorate is a chemical compound, with the formula Sr(ClO₃)₂.[https://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?q=all&cid=24641#ec PubChem] It is a strong oxidizing agent.