Succinyl chloride

{{Chembox

| ImageFile = Succinyl chloride.png

| ImageSize =

| ImageAlt =

| PIN = Butanedioyl dichloride

| OtherNames = Succinic acid dichloride, succinoyl dichloride

| Section1 = {{Chembox Identifiers

| CASNo = 543-20-4

| PubChem = 10970

| EC_number = 208-838-0

| ChemSpiderID = 13867055

| UNII = GDN09V9867

| InChI=1S/C4H4Cl2O2/c5-3(7)1-2-4(6)8/h1-2H2

| InChIKey= IRXBNHGNHKNOJI-UHFFFAOYSA-N

| SMILES = ClC(=O)CCC(Cl)=O

}}

| Section2 = {{Chembox Properties

| C=4 | O=2 | Cl = 2 | H=4

| Appearance = colorless liquid

| Density = 1.41 g·ml−1

| MeltingPtC = 15-18

| BoilingPtC = 190

| BoilingPt_notes =

| Solubility = Reacts violently with water

}}

| Section3 = {{Chembox Hazards

| GHSPictograms = {{GHS05}}

| GHSSignalWord= Danger

| HPhrases = {{H-phrases|227|314|}}

| PPhrases = {{P-phrases|280|310|303+361+353|305+351+338|405|}}

| MainHazards =

| FlashPtC = 76

| AutoignitionPt =

}}

}}

Succinyl chloride is the organic compound with the formula (CH₂)₂(COCl)₂.{{cite web | title = Butanedioyl dichloride| publisher=US National Library of Medicine | url = https://pubchem.ncbi.nlm.nih.gov/compound/succinyl_chloride | accessdate =13 April 2019}} It is the acyl chloride derivative of succinic acid and a simple diacid chloride. It is a colorless liquid. It used as a reagent in organic synthesis.