Succinylsulfathiazole

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 443214593

| IUPAC_name = 4-oxo-4-({4-[(1,3-thiazol-2-ylamino)sulfonyl]phenyl}amino)butanoic acid

| image = Succinylsulfathiazole.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 116-43-8

| ATC_prefix = A07

| ATC_suffix = AB04

| PubChem = 5315

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL = 1484857

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = RSS8647O4S

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07060

| C=13 | H=13 | N=3 | O=5 | S=2

| SMILES = OC(=O)CCC(=O)Nc1ccc(cc1)S(=O)(=O)Nc2nccs2

}}

Succinylsulfathiazole (also known as sulfasuxidine) is a sulfonamide.{{Cite journal | vauthors = Poth EJ, Knotts FL |date= February 1942 |title=Clinical use of Succinylsulfathiazole |url=http://archsurg.jamanetwork.com/article.aspx?doi=10.1001/archsurg.1942.01210200024002 |journal=Archives of Surgery |language=en |volume=44 |issue=2 |pages=208 |doi=10.1001/archsurg.1942.01210200024002 |issn=0004-0010}}{{cite journal | vauthors = Dixon CF, Benson RE | title = Closure of Colonic Stoma: Improved Results With Combined Succinylsulfathiazole and Sulfathiazole Therapy | language = en-US | journal = Annals of Surgery | volume = 120 | issue = 4 | pages = 562–571 | date = October 1944 | pmid = 17858511 | pmc = 1618178 | doi = 10.1097/00000658-194410000-00012 }} It is also spelled as succinylsulphathiazole. It is a white or yellow-white crystalline powder. It dissolves in aqueous solutions of alkali hydroxides and carbonates but is very slightly soluble in water.

It is classified as ultra long-acting drug. About 95% of the drug remains in the intestine and only 5% is hydrolyzed, slowly, to sulfathiazole and is absorbed.

The drug is used for its antibacterial activity in the GIT. The dose is 10g - 20g daily in divided doses.

The Succinyl group is attached to form a prodrug for the controlled release of the drug sulfathiazole.