Sudan Red 7B

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470482978

| ImageFile1 = Sudan Red 7B.png

| ImageSize1 = 200px

| ImageFile2 = Sudan-Red-7B-3D-balls.png

| ImageSize2 = 200px

| ImageAlt =

| PIN = N-Ethyl-1-{[4-(phenyldiazenyl)phenyl]diazenyl}naphthalen-2-amine

| OtherNames = Solvent Red 19; Ceres Red 7B; Fat Red 7B; Hexatype carmine B; Lacquer red V3B; Oil violet; Organol bordeaux B; Sudanrot 7B; Typogen carmine; C.I. 26050; N-ethyl-1-[[p-(phenylazo)phenyl]azo]-2-naphthalenamine

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 55325

| InChI1 = 1/C24H21N5/c1-2-25-23-17-12-18-8-6-7-11-22(18)24(23)29-28-21-15-13-20(14-16-21)27-26-19-9-4-3-5-10-19/h3-17,25H,2H2,1H3/b27-26+,29-28+

| InChIKey1 = VKWNTWQXVLKCSG-ZDXBJJIEBU

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C24H21N5/c1-2-25-23-17-12-18-8-6-7-11-22(18)24(23)29-28-21-15-13-20(14-16-21)27-26-19-9-4-3-5-10-19/h3-17,25H,2H2,1H3/b27-26+,29-28+

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = VKWNTWQXVLKCSG-ZDXBJJIESA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 6368-72-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8QUH39Y06P

| PubChem = 61396

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C19529

| SMILES = N(=N/c3ccc(/N=N/c1c2c(ccc1NCC)cccc2)cc3)\c4ccccc4

}}

|Section2={{Chembox Properties

| C=24 | H=21 | N=5

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Sudan Red 7B, also known as Solvent Red 19, Ceres Red 7B, Fat Red 7B, Hexatype carmine B, Lacquer red V3B, Oil violet, Organol bordeaux B, Sudanrot 7B, Typogen carmine, and C.I. 26050, is a red diazo dye.{{Cite web |last=PubChem |title=Sudan Red 7B |url=https://pubchem.ncbi.nlm.nih.gov/compound/61396 |access-date=2022-11-22 |website=pubchem.ncbi.nlm.nih.gov |language=en}}{{Cite web |title=Sudan Red 7B {{!}} CAS 6368-72-5 |url=https://www.scbt.com/p/sudan-red-7b-6368-72-5;jsessionid=rlygG9QzhA0r5zz5L3ceFpHAaBMJp6YW_ZemDyU8Ms5d4bsZCOY9!-310854664 |access-date=2022-11-22 |website=www.scbt.com |language=en}}{{Cite web |title=Sudan Red 7B (CAS 6368-72-5) |url=https://www.caymanchem.com/product/33315 |access-date=2022-11-22 |website=www.caymanchem.com |language=en}} Chemically it is N-ethyl-1-[[p-(phenylazo)phenyl]azo]-2-naphthalenamine. It is soluble in oils and insoluble in water.

It is used in biology for staining, and in industry as one of the fuel dyes. It can be also present in red laser toners.