Sudan Yellow 3G

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470482820

| ImageFile = Sudan Yellow 3G.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 3-Methyl-1-phenyl-4-(phenyldiazenyl)-1H-pyrazol-5(4H)-one

| PIN =

| OtherNames = Solvent Yellow 16; C.I. disperse yellow; C.I. 12700; 4-phenylazo-1-phenyl-3-methyl-5-pyrazolone; 2,4-dihydro-5-methyl-2-phenyl-4-(phenylazo)-3H-pyrazol-3-one

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 14850402

| InChI = 1/C16H14N4O/c1-12-15(18-17-13-8-4-2-5-9-13)16(21)20(19-12)14-10-6-3-7-11-14/h2-11,19H,1H3/b18-17+

| InChIKey = XOCUHWXGSSSCTJ-ISLYRVAYBE

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H14N4O/c1-12-15(18-17-13-8-4-2-5-9-13)16(21)20(19-12)14-10-6-3-7-11-14/h2-11,19H,1H3/b18-17+

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XOCUHWXGSSSCTJ-ISLYRVAYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 4314-14-1

| ChEMBL = 3145171

| EINECS = 224-330-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = N83897KOD7

| PubChem = 624132

| SMILES = CC=3NN(c1ccccc1)C(=O)C=3/N=N/c2ccccc2

}}

|Section2={{Chembox Properties

| C=16 | H=14 | N=4 | O=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Sudan Yellow 3G, also known as Solvent Yellow 16, C.I. disperse yellow and C.I. 12700, is a yellow azo dye. It is soluble in fats and oils.{{Ullmann|first1 = Klaus|last1 = Hunger|first2 = Peter|last2 = Mischke|first3 = Wolfgang|last3 = Rieper|first4 = Roderich|last4 = Raue|first5 = Klaus|last5 = Kunde|first6 = Aloys|last6 = Engel|title = Azo Dyes|year = 2005|doi = 10.1002/14356007.a03_245}}

Sudan Yellow 3G is used as a pigment in cosmetics and printer toners, and as a dye in inks, including inks for inkjet printers. In pyrotechnics, it is used in some yellow colored smokes.