Sulbenicillin

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 408887617

| IUPAC_name = (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-phenyl-2-sulfoacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid

| image = Sulbenicillin.svg

| tradename =

| Drugs.com = {{drugs.com|international|sulbenicillin}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 41744-40-5

| CAS_supplemental = {{CAS|28002-18-8}}

| ATC_prefix = J01

| ATC_suffix = CA16

| ATC_supplemental =

| PubChem = 39031

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = Q2VYF0562D

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08534

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 564107

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 16736045

| chemical_formula =

| C=16 | H=18 | N=2 | O=7 | S=2

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H18N2O7S2/c1-16(2)11(15(21)22)18-13(20)9(14(18)26-16)17-12(19)10(27(23,24)25)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,17,19)(H,21,22)(H,23,24,25)/t9-,10-,11+,14-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = JETQIUPBHQNHNZ-NJBDSQKTSA-N

| SMILES = CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](c3ccccc3)S(=O)(=O)O)C(=O)O)C

}}

Sulbenicillin (INN) is a penicillin antibiotic, notable for its combination use with dibekacin. {{cite journal |vauthors=Aonuma S, Ariji F, Oizumi K, Konno K |date=June 1987 |title=Electron microscopy of Pseudomonas aeruginosa treated with sulbenicillin and dibekacin |url=https://www.jstage.jst.go.jp/article/tjem1920/152/2/152_2_119/_article |journal=Tohoku J. Exp. Med. |volume=152 |issue=2 |pages=119–28 |doi=10.1620/tjem.152.119 |pmid=3114912 |doi-access=free}} Penicillins, crucial in primary healthcare for potent bactericidal properties and wide distribution, include oral options for enhanced accessibility. Post-World War II, synthetic penicillins like sulbenicillin broadened efficacy, leading to new groups that diversified treatment. This evolution reflects a dynamic interplay between science and clinical needs, emphasizing enduring value in managing infectious diseases in primary care.