Sulfadicramide
{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| drug_name =
| INN =
| type =
| image = Sulfadicramide.png
| width =
| alt =
| caption =
| image2 =
| width2 =
| alt2 =
| caption2 =
| imageL =
| widthL =
| altL =
| imageR =
| widthR =
| altR =
| captionLR =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_category=
| dependency_liability =
| addiction_liability =
| routes_of_administration =
| class =
| ATCvet =
| ATC_prefix = S01
| ATC_suffix = AB03
| ATC_supplemental =
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US =
| legal_US_comment =
| legal_EU =
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action=
| excretion =
| CAS_number = 115-68-4
| CAS_supplemental =
| PubChem = 8281
| PubChemSubstance =
| IUPHAR_ligand =
| DrugBank = DB13214
| ChemSpiderID =
| UNII = 7WZ5EG263C
| KEGG = D07412
| ChEBI = 135039
| ChEMBL = 2104910
| NIAID_ChemDB =
| PDB_ligand =
| synonyms =
| IUPAC_name =
| C=11 | H=14 | N=2 | O=3 | S=1
| molecular_weight =
| SMILES = CC(=CC(=O)NS(=O)(=O)C1=CC=C(C=C1)N)C
| Jmol =
| StdInChI = InChI=1S/C11H14N2O3S/c1-8(2)7-11(14)13-17(15,16)10-5-3-9(12)4-6-10/h3-7H,12H2,1-2H3,(H,13,14)
| StdInChI_comment =
| StdInChIKey = XRVJPLDTMUSSDE-UHFFFAOYSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
Sulfadicramide (marketed as Irgamid) is an anti-infective.{{cite journal | vauthors = Grześkowiak E, Partyka D, Simon M, Zgrabczyńska M, Wiśniewska A | title = Technology and physico-chemical evaluation of solid ocular inserts containing sulfadicramide and hyaluronic acid | journal = Acta Poloniae Pharmaceutica | volume = 58 | issue = 6 | pages = 453–458 | year = 2001 | pmid = 12197618 }}
References
{{reflist}}
{{Nucleic acid inhibitors}}
{{Ophthalmological anti-infectives}}
{{pharma-stub}}
Category:Sulfonamide antibiotics
Category:4-Aminophenyl compounds
{{antiinfective-drug-stub}}