Sulfadimidine

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 470472902

| IUPAC_name = 4-amino-N-(4,6-dimethylpyrimidin-2-yl)
benzene-1-sulfonamide

| image = Sulfadimidine.svg

| drug_name = Sulfamethazine

| tradename =

| Drugs.com = {{drugs.com|international|sulfamethazine}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 57-68-1

| ATC_prefix = J01

| ATC_suffix = EB03

| ATC_supplemental = {{ATCvet|J01|EQ03}} {{ATCvet|P51|AG01}} {{ATCvet|P51|AG51}}

| PubChem = 5327

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01582

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5136

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 48U51W007F

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02436

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 102265

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 446

| NIAID_ChemDB = 027749

| C=12 | H=14 | N=4 | O=2 | S=1

| smiles = O=S(=O)(Nc1nc(cc(n1)C)C)c2ccc(N)cc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C12H14N4O2S/c1-8-7-9(2)15-12(14-8)16-19(17,18)11-5-3-10(13)4-6-11/h3-7H,13H2,1-2H3,(H,14,15,16)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ASWVTGNCAZCNNR-UHFFFAOYSA-N

| melting_point = 176

|alt=|caption=|type=|MedlinePlus=|licence_EU=|licence_US=}}

Sulfadimidine or sulfamethazine is a sulfonamide antibacterial.

There are non-standardized{{Ref|reference_name_A|a}} abbreviations for it as "sulfadimidine" (abbreviated SDI{{cite journal | vauthors = Romváry A, Simon F | title = Sulfonamide residues in eggs | journal = Acta Veterinaria Hungarica | volume = 40 | issue = 1–2 | pages = 99–106 | year = 1992 | pmid = 1476095 }}{{cite journal | vauthors = Reddy KS, Jain SK, Uppal RP |year=1988 |title=Pharmacokinetic studies of sulphonamides in poultry |journal=Indian Journal of Animal Sciences}} and more commonly but less reliably{{Ref|reference_name_B|b}} SDD{{cite journal | vauthors = Kamakura K, Hasegawa M, Koiguchi S, Miyata M, Okamoto K, Narita M, Hirahara Y, Yamana T, Tonogai Y, Ito Y | display-authors = 6 | title = [Studies on the identification of sulfadimidine in pork by high performance liquid chromatography with photodiode array detector and gas chromatograph-mass spectrometry] | journal = Eisei Shikenjo Hokoku. Bulletin of National Institute of Hygienic Sciences | issue = 111 | pages = 61–5 | year = 1993 | pmid = 7920569 }}{{cite journal | vauthors = Garg SK, Ghosh SS, Mathur VS | title = Comparative pharmacokinetic study of four different sulfonamides in combination with trimethoprim in human volunteers | journal = International Journal of Clinical Pharmacology, Therapy, and Toxicology | volume = 24 | issue = 1 | pages = 23–5 | date = January 1986 | pmid = 3485584 }}) and as "sulfamethazine" (abbreviated SMT{{cite journal | vauthors = Peña MS, Salinas F, Mahedero MC, Aaron JJ | title = Solvent effect on the determination of sulfamethazine by room-temperature photochemically induced fluorescence | journal = Talanta | volume = 41 | issue = 2 | pages = 233–6 | date = February 1994 | pmid = 18965913 | doi = 10.1016/0039-9140(94)80113-4 }}{{cite journal | vauthors = Kaniou S, Pitarakis K, Barlagianni I, Poulios I | title = Photocatalytic oxidation of sulfamethazine | journal = Chemosphere | volume = 60 | issue = 3 | pages = 372–80 | date = July 2005 | pmid = 15924956 | doi = 10.1016/j.chemosphere.2004.11.069 | bibcode = 2005Chmsp..60..372K }} and more commonly but less reliably{{Ref|reference_name_C|c}} SMZ{{cite journal | vauthors = Calvo R, Sarabia S, Carlos R, Du Souich P | title = Sulfamethazine absorption and disposition: effect of surgical procedures for gastroduodenal ulcers | journal = Biopharmaceutics & Drug Disposition | volume = 8 | issue = 2 | pages = 115–24 | date = Mar 1987 | pmid = 3593892 | doi = 10.1002/bdd.2510080203 }}{{cite journal | vauthors = De Liguoro M, Fioretto B, Poltronieri C, Gallina G | title = The toxicity of sulfamethazine to Daphnia magna and its additivity to other veterinary sulfonamides and trimethoprim | journal = Chemosphere | volume = 75 | issue = 11 | pages = 1519–24 | date = June 2009 | pmid = 19269673 | doi = 10.1016/j.chemosphere.2009.02.002 | bibcode = 2009Chmsp..75.1519D }}). Other names include sulfadimerazine, sulfadimezine, and sulphadimethylpyrimidine.{{cn|date=January 2023}}