Sulfafurazole

{{Short description|Chemical compound}}

{{ref improve|date=August 2014}}

{{confused|sulfadiazine}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 408901459

| IUPAC_name = 4-Amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide

| image = Sulfafurazole.svg

| tradename =

| Drugs.com = {{drugs.com|international|sulfafurazole}}

| MedlinePlus = a601049

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category = To be avoided within two months of term

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion = Excreted unchanged in urine

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 127-69-5

| ATC_prefix = J01

| ATC_suffix = EB05

| ATC_supplemental = {{ATC|S01|AB02}} {{ATCvet|J01|EQ05}}

| PubChem = 5344

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB00263

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 740T4C525W

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00450

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 453

| ChemSpiderID = 5151

| C=11 | H=13 | N=3 | O=3 | S=1

| smiles = Cc1c(C)noc1NS(=O)(=O)c2ccc(N)cc2

| StdInChI = 1S/C11H13N3O3S/c1-7-8(2)13-17-11(7)14-18(15,16)10-5-3-9(12)4-6-10/h3-6,14H,12H2,1-2H3

| StdInChIKey = NHUHCSRWZMLRLA-UHFFFAOYSA-N

| melting_point = 194

}}

Sulfafurazole (INN, also known as sulfisoxazole) is a sulfonamide antibacterial with a dimethyl-isoxazole substituent. It possesses antibiotic activity against a wide range of Gram-negative and Gram-positive organisms.{{cite book | vauthors = Holmes NE, Grauson ML | chapter = Sulfonamides | pages = 1571–1624 | veditors = Paterson DL, McCarthy JS, Mouton JW, Mills J, Grayson ML, Cosgrove SE, Crowe S, Hope W | title = Kucers' The Use of Antibiotics | edition = 7th | publisher = CRC Press | date = October 2017 | isbn = 978-1-4987-4796-7 }} It is sometimes given in combination with erythromycin (see erythromycin/sulfafurazole) or phenazopyridine. It is used locally in a 4% solution or ointment.