Sulfinalol
{{Chembox
| ImageFile = Sulfinalol.svg
| ImageSize = 200px
| ImageAlt =
| IUPACName = 4-[1-Hydroxy-2-[4-(4-methoxyphenyl)butan-2-ylamino]ethyl]-2-methylsulfinylphenol
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 66264-77-5
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = PH7O14792O
| PubChem = 44439
| InChI=1S/C20H27NO4S/c1-14(4-5-15-6-9-17(25-2)10-7-15)21-13-19(23)16-8-11-18(22)20(12-16)26(3)24/h6-12,14,19,21-23H,4-5,13H2,1-3H3
| InChIKey= PAQZZCOZHPGCFW-UHFFFAOYSA-N
| ChemSpiderID =
| SMILES = CC(CCC1=CC=C(C=C1)OC)NCC(C2=CC(=C(C=C2)O)S(=O)C)O}}
|Section2={{Chembox Properties
| C=20 | H=27 | N=1 | O=4 | S=1
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
{{More citations needed|date=March 2021}}
Sulfinalol is a beta adrenergic receptor antagonist.{{cite journal|pmid=6182405 | volume=4 | issue=5 | title=Studies on the mechanism of the acute antihypertensive and vasodilator actions of several beta-adrenoceptor antagonists | year=1982 | journal=J. Cardiovasc. Pharmacol. | pages=749–58| last1=Sybertz | first1=E. J. | last2=Baum | first2=T. | last3=Pula | first3=K. K. | last4=Nelson | first4=S. | last5=Eynon | first5=E. | last6=Sabin | first6=C. | doi=10.1097/00005344-198209000-00009 | s2cid=34100646 | doi-access=free }}
Synthesis
The methyl group on a sulfoxide is sufficiently acidic to substitute for phenolic hydroxyl.
File:Sulfinalol synthesis.svg|inventor1-last=Philion|inventor1-first=Richard Everett}} R. E. Philion, (1978 to Sterling), C.A. 90, 137468 (1979).]]
The preparation of this combined α- and β-blocker sulfinalol begins by protection of the phenolic hydroxyl as its benzoate ester. Bromination followed by condensation with 4-(4-methoxyphenyl)butan-2-amine (not PMA) gives the aminoketone 3. Successive catalytic reduction and saponification affords aminoalcohol 4. Oxidation of the sulfide to the sulfoxide with a reagent such as metaperiodate gives sulfinalol (5).