Sulisobenzone

{{chembox

| verifiedrevid = 408915915

| Reference=Merck Index, 11th Edition, 8963.

| ImageFile=Sulisobenzon Structural Formula V.1.svg

| ImageSize=250px

| ImageAlt = Skeletal formula of sulisobenzone

| ImageFile2=Sulisobenzone-3D-balls.png

| ImageAlt2 = Ball-and-stick model of the sulisobenzone molecule

| PIN=5-Benzoyl-4-hydroxy-2-methoxybenzene-1-sulfonic acid

| OtherNames=Benzophenone-4

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 18829

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1W6L629B4K

| InChI = 1/C14H12O6S/c1-20-12-8-11(15)10(7-13(12)21(17,18)19)14(16)9-5-3-2-4-6-9/h2-8,15H,1H3,(H,17,18,19)

| InChIKey = CXVGEDCSTKKODG-UHFFFAOYAQ

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H12O6S/c1-20-12-8-11(15)10(7-13(12)21(17,18)19)14(16)9-5-3-2-4-6-9/h2-8,15H,1H3,(H,17,18,19)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CXVGEDCSTKKODG-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=4065-45-6

| PubChem=19988

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D05964

| SMILES = O=S(=O)(O)c1cc(c(O)cc1OC)C(=O)c2ccccc2

}}

|Section2={{Chembox Properties

| Formula=C14H12O6S

| MolarMass=308.31 g/mol

| Appearance=Light-tan powder

| Density=

| MeltingPtC= 145

| BoilingPt=

| Solubility= 1 g per 4 mL

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Sulisobenzone (benzophenone-4) is an ingredient in some sunscreens which protects the skin from damage by UVB and UVA ultraviolet light.{{cite journal |vauthors=Nohynek GJ, Schaefer H |title=Benefit and risk of organic ultraviolet filters |journal=Regul. Toxicol. Pharmacol. |volume=33 |issue=3 |pages=285–99 |date=June 2001 |pmid=11407932 |doi=10.1006/rtph.2001.1476 }}[http://www.skincancer.org/understanding-uva-and-uvb.html Skin cancer foundation: Understanding UVA and UVB]

Its sodium salt, sulisobenzone sodium, is also referred to as benzophenone-5.

References