Sulisobenzone
{{chembox
| verifiedrevid = 408915915
| Reference=Merck Index, 11th Edition, 8963.
| ImageFile=Sulisobenzon Structural Formula V.1.svg
| ImageSize=250px
| ImageAlt = Skeletal formula of sulisobenzone
| ImageFile2=Sulisobenzone-3D-balls.png
| ImageAlt2 = Ball-and-stick model of the sulisobenzone molecule
| PIN=5-Benzoyl-4-hydroxy-2-methoxybenzene-1-sulfonic acid
| OtherNames=Benzophenone-4
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 18829
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1W6L629B4K
| InChI = 1/C14H12O6S/c1-20-12-8-11(15)10(7-13(12)21(17,18)19)14(16)9-5-3-2-4-6-9/h2-8,15H,1H3,(H,17,18,19)
| InChIKey = CXVGEDCSTKKODG-UHFFFAOYAQ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H12O6S/c1-20-12-8-11(15)10(7-13(12)21(17,18)19)14(16)9-5-3-2-4-6-9/h2-8,15H,1H3,(H,17,18,19)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CXVGEDCSTKKODG-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=4065-45-6
| PubChem=19988
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D05964
| SMILES = O=S(=O)(O)c1cc(c(O)cc1OC)C(=O)c2ccccc2
}}
|Section2={{Chembox Properties
| Formula=C14H12O6S
| MolarMass=308.31 g/mol
| Appearance=Light-tan powder
| Density=
| MeltingPtC= 145
| BoilingPt=
| Solubility= 1 g per 4 mL
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Sulisobenzone (benzophenone-4) is an ingredient in some sunscreens which protects the skin from damage by UVB and UVA ultraviolet light.{{cite journal |vauthors=Nohynek GJ, Schaefer H |title=Benefit and risk of organic ultraviolet filters |journal=Regul. Toxicol. Pharmacol. |volume=33 |issue=3 |pages=285–99 |date=June 2001 |pmid=11407932 |doi=10.1006/rtph.2001.1476 }}[http://www.skincancer.org/understanding-uva-and-uvb.html Skin cancer foundation: Understanding UVA and UVB]
Its sodium salt, sulisobenzone sodium, is also referred to as benzophenone-5.