Suosan

{{chembox

| Watchedfields = changed

| verifiedrevid = 424993698

| ImageFile = Suosan.png

| ImageSize = 200px

| IUPACName = Sodium N-[(4-nitrophenyl)carbamoyl]-β-alaninate

| SystematicName = Sodium 3-{[(4-nitrophenyl)carbamoyl]amino}propanoate

| OtherNames = N-(((4-Nitrophenyl)amino)carbonyl)-β-alanine monosodium salt

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 140-46-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6V7T3M79X3

| PubChem = 8803

| SMILES = C1=CC(=CC=C1NC(=O)NCCC(=O)O)[N+](=O)[O-] }}

|Section2={{Chembox Properties

| C=10 | H=10 | N=3 | Na=1 | O=5

| Appearance =

| Density =

| MeltingPtC = 240

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Suosan is calorie-free artificial sweetener derived from β-alanine, discovered in 1948 by Petersen et Muller.{{cite journal|author1=Petersen S|author2=Muller E|title=Über eine neue Gruppe von Süsstoffen (On a new group of sweet substances)|journal=Chemische Berichte|date=1948|pages=31–38|volume=81 | doi=10.1002/cber.19480810105 }}

Suosan is a sodium salt of p-Nitrophenylcarbamidopropionic acid and is 700 times sweeter than sucrose (table sugar){{Cite journal | last1 = Santhosh | first1 = C. | last2 = Mishra | first2 = P. C. | doi = 10.1002/qua.560510510 | title = Electrostatic potential and electric field mapping of some sweeteners of the suosan series: A search for the structure-activity relationship | journal = International Journal of Quantum Chemistry | volume = 51 | issue = 5 | pages = 335 | year = 1994 }} with a bitter aftertaste.{{cite book | author = AD Kinghorn & CM Compadre | title = Alternative Sweeteners | edition = Third | editor = Marcel Dekker | location = New York | year = 2001 | isbn = 0-8247-0437-1 | chapter = Less common high-potency sweeteners | pages = 208–234}} It was never commercialized due to its low solubility in water, particularly under acidic pH (which limited its use, particularly in soft drinks){{cite journal|last1=Muller|first1=George W|last2=Culberson|first2=J. Chris|last3=Roy|first3=Glenn|last4=Ziegler|first4=Jeanette|last5=Walters|first5=D. Eric|last6=Kellogg|first6=Michael S.|last7=Schiffman|first7=Susan S.|last8=Warwick|first8=Zoe S|title=Carboxylic acid replacement structure-activity relationships in suosan type sweeteners. A sweet taste antagonist. 1|journal=J. Med. Chem.|date=May 1992|volume=35|issue=10|pages=1747–1751|doi=10.1021/jm00088a008|pmid=1588556}}{{cite web|last1=Nofre|first1=Claude|last2=Tinti|first2=Jean M|last3=Chatzopoulos|first3=Farroudja O|title=Pyridinyl compounds of N-carbamoyl-N-thiocarbamoyl- or N-amidino-glycine or beta-alanine useful as sweetening agents. US Patent 4997667 A|url=https://patents.google.com/patent/US4997667|access-date=14 September 2014|date=Mar 5, 1991}} and concerns that it might form the toxic compound 4-nitroaniline.