Syringin
{{Chembox
| ImageFile = syringin.svg
| IUPACName = 4-[(1E)-3-Hydroxyprop-1-en-1-yl]-2,6-dimethoxyphenyl β-D-glucopyranoside
| SystematicName = (2R,3S,4S,5R,6S)-2-(Hydroxymethyl)-6-
| OtherNames = Eleutheroside B; Ilexanthin A; Ligustrin; Lilacin; Magnolenin; Methoxyconiferine; Sinapyl alcohol 4-O-glucoside; Siringin; Syringoside
|Section1={{Chembox Identifiers
| CASNo = 118-34-3
| CASNo_Ref = {{cascite|correct|CAS}}
| ChEBI = 9380
| ChEMBL = 250872
| ChemSpiderID = 4475831
| EC_number = 601-519-0
| KEGG = C01533
| PubChem = 5316860
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = I6F5B11C96
| SMILES = O(c1c(OC)cc(/C=C/CO)cc1OC)[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)CO
| InChI = 1/C17H24O9/c1-23-10-6-9(4-3-5-18)7-11(24-2)16(10)26-17-15(22)14(21)13(20)12(8-19)25-17/h3-4,6-7,12-15,17-22H,5,8H2,1-2H3/b4-3+/t12-,13-,14+,15-,17+/m1/s1
| InChIKey = QJVXKWHHAMZTBY-GCPOEHJPBY
| StdInChI = 1S/C17H24O9/c1-23-10-6-9(4-3-5-18)7-11(24-2)16(10)26-17-15(22)14(21)13(20)12(8-19)25-17/h3-4,6-7,12-15,17-22H,5,8H2,1-2H3/b4-3+/t12-,13-,14+,15-,17+/m1/s1
| StdInChIKey = QJVXKWHHAMZTBY-GCPOEHJPSA-N
}}
|Section2={{Chembox Properties
| C=17 | H=24 | O=9
| Appearance = White crystalline solid
| Density =
| MeltingPtC = 192
| MeltingPt_ref = Merck Index, 11th Edition, 8997
| BoilingPt =
| Solubility = Slightly soluble
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Syringin is a natural chemical compound first isolated from the bark of lilac (Syringa vulgaris) by Meillet in 1841.{{cite journal|title=Syringin 4-O-β-Glucoside, a New Phenylpropanoid Glycoside, and Costunolide, a Nitric Oxide Synthase Inhibitor, from the Stem Bark of Magnolia sieboldii|journal=Journal of Natural Products|volume=59|issue=12|pages=1128–1130|doi=10.1021/np960452i|pmid=8988596|year=1996|last1=Park|first1=Hee-Juhn|last2=Jung|first2=Won-Tae|last3=Basnet|first3=Purusotam|last4=Kadota|first4=Shigetoshi|last5=Namba|first5=Tsuneo}} It has since been found to be distributed widely throughout many types of plants. It is also called eleutheroside B, and is found in Eleutherococcus senticosus (Siberian ginseng). It is also found in dandelion coffee. Syringin may potentially have antidiabetic effects.{{cite journal|title=Isolation, characterization of syringin, phenylpropanoid glycoside from Musa paradisiaca tepal extract and evaluation of its antidiabetic effect in streptozotocin-induced diabetic rats|journal=Biomedicine & Preventive Nutrition|volume=4|issue=2|pages=105–111|doi=10.1016/j.bionut.2013.12.009|year=2014|last1=Sundaram Chinna Krishnan|first1=Shanmuga|last2=Pillai Subramanian|first2=Iyyam|last3=Pillai Subramanian|first3=Sorimuthu}}
Chemically, it is the glucoside of sinapyl alcohol.
References
{{reflist}}
External links
- {{Commonscat-inline}}
Category:Phenylpropanoid glucosides
Category:Hydroxymethyl compounds
{{aromatic-stub}}