T-0156

{{Chembox

| ImageFile = T-0156.svg

| ImageSize = 225

| ImageAlt =

| PIN = Methyl 2-[(2-methylpyridin-4-yl)methyl]-1-oxo-8-[(pyrimidin-2-yl)methoxy]-4-(3,4,5-trimethoxyphenyl)-1,2-dihydro-2,7-naphthyridine-3-carboxylate

| OtherNames = T0156

| Section1 = {{Chembox Identifiers

| IUPHAR_ligand = 5275

| CASNo = 324572-93-2

| CASNo_Ref = {{Cascite|changed|IUPHAR}}

| ChEMBL = 1190161

| ChEBI = 93111

| ChEMBL1 = 540294

| PubChem = 5368

| PubChem1 = 9852041

| index1_label = (HCl)

| ChemSpiderID = 5175

| ChemSpiderID1 = 8027754

| StdInChI =1S/C31H29N5O7/c1-18-13-19(7-11-32-18)16-36-27(31(38)42-5)25(20-14-22(39-2)28(41-4)23(15-20)40-3)21-8-12-35-29(26(21)30(36)37)43-17-24-33-9-6-10-34-24/h6-15H,16-17H2,1-5H3

| StdInChIKey = JEMJAABFSYOLAP-UHFFFAOYSA-N

| SMILES = CC1=NC=CC(=C1)CN2C(=C(C3=C(C2=O)C(=NC=C3)OCC4=NC=CC=N4)C5=CC(=C(C(=C5)OC)OC)OC)C(=O)OC

| InChI1=1S/C31H29N5O7.ClH/c1-18-13-19(7-11-32-18)16-36-27(31(38)42-5)25(20-14-22(39-2)28(41-4)23(15-20)40-3)21-8-12-35-29(26(21)30(36)37)43-17-24-33-9-6-10-34-24;/h6-15H,16-17H2,1-5H3;1H

| InChIKey1 = RBJCBXAXUHCWBR-UHFFFAOYSA-N

| SMILES1 = CC1=NC=CC(=C1)CN2C(=C(C3=C(C2=O)C(=NC=C3)OCC4=NC=CC=N4)C5=CC(=C(C(=C5)OC)OC)OC)C(=O)OC.Cl

}}

| Section2 = {{Chembox Properties

| C=31 | H=29 | N=5 | O=7

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

T-0156 is a phosphodiesterase 5 inhibitor.{{cite journal | last1 = Parlak | first1 = A | last2 = Yildirim | first2 = S | last3 = Bagcivan | first3 = I | last4 = Durmus | first4 = N | title = Role of New Agents Affecting NO/cGMP Pathway on Ovalbumin-Sensitized Guinea Pig Trachea | journal = Experimental Lung Research | date = October 2012 | volume = 38 | issue = 8 | pages = 420–6 | doi = 10.3109/01902148.2012.719281 | pmid = 23030645| s2cid = 22720639 }}{{cite journal | last1 = Santos | first1 = AI | last2 = Carreira | first2 = BP | last3 = Nobre | first3 = RJ | last4 = Carvalho | first4 = CM | last5 = Araújo | first5 = IM | title = Stimulation of Neural Stem Cell Proliferation by Inhibition of Phosphodiesterase 5 | journal = Stem Cells International | date = 2014 | volume = 2014 | pages = 878397 | doi = 10.1155/2014/878397 | pmid = 24550991 | pmc = 3914480| doi-access = free }}