T-1123

{{Chembox

| Name = T-1123

| ImageFile = T-1123.svg

| PIN = N,N-Diethyl-N-methyl-3-[(methylcarbamoyl)oxy]anilinium iodide

| OtherNames = AR-16, TL-1217

| Section1 = {{Chembox Identifiers

| ChemSpiderID = 39424

| PubChem = 43257

| CASNo = 60398-22-3

| StdInChI= InChI=1S/C13H20N2O2.HI/c1-5-15(4,6-2)11-8-7-9-12(10-11)17-13(16)14-3;/h7-10H,5-6H2,1-4H3;1H

| StdInChIKey= XYPQGNNSAIEXIS-UHFFFAOYSA-N

| SMILES = CC[N+](C)(CC)C1=CC(=CC=C1)OC(=O)NC.[I-]

}}

| Section2 = {{Chembox Properties

| C = 13 | H =21 | N = 2 | O = 2 |I=1

}}

| Section3 = {{Chembox Related

| OtherCompounds = Neostigmine
Miotine

}}

| Section4 = {{Chembox Hazards

| LD50 = 129 μg/kg (Subcutaneous, mice)
75 μg/kg (Subcutaneous, cats)
75 μg/kg (Subcutaneous, dogs)
150 μg/kg (Subcutaneous, rabbits)
122.5 μg/kg (Intramuscular, rats){{cite journal |last1=Bajgar |first1=J |last2=Patocka |first2=J |title=Anticholinesterase action of 3-diethylaminophenyl-N-methyl-carbamate methiodide in vitro and in vivo. |journal=Acta Biologica et Medica Germanica |date=1976 |volume=35 |issue=3–4 |pages=479–84 |pmid=970052}}

}}

| Section5 =

| Section6 =

}}

T-1123 is a carbamate-based acetylcholinesterase inhibitor. It was investigated as a chemical warfare agent starting in 1940. It does not go through the blood-brain barrier due to the charge on quaternary nitrogen. The antidote is atropine.{{cite book|last1=Gupta|first1=Ramesh C.|title=Handbook of Toxicology of Chemical Warfare Agents|date=2015|publisher=Academic Press|isbn=9780128004944|pages=338–339|url=https://books.google.com/books?id=MXKDBAAAQBAJ&pg=PA338|language=en}} T-1123 is a quaternary ammonium ion. A phenyl carbamate ester is bonded in the meta position to the nitrogen on a diethylmethyl amine. The chloride and methylsulfate salt of T-1123 is TL-1299 and TL-1317, respectively.