TAPS (buffer)

{{Chembox

| Name = TAPS

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 449646540

| ImageFile = TAPS.svg

| ImageSize =

| ImageAlt =

| PIN = 3-{[1,3-Dihydroxy-2-(hydroxymethyl)propan-2-yl]amino}propane-1-sulfonic acid

| OtherNames = N-Tris(hydroxymethyl)methyl-3-aminopropanesulfonic acid

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 29915-38-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Y5DC3IN066

| PubChem = 121591

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 108495

| SMILES = C(CNC(CO)(CO)CO)CS(=O)(=O)O

| InChI = 1/C7H17NO6S/c9-4-7(5-10,6-11)8-2-1-3-15(12,13)14/h8-11H,1-6H2,(H,12,13,14)

| InChIKey = YNLCVAQJIKOXER-UHFFFAOYAP

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C7H17NO6S/c9-4-7(5-10,6-11)8-2-1-3-15(12,13)14/h8-11H,1-6H2,(H,12,13,14)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = YNLCVAQJIKOXER-UHFFFAOYSA-N}}

|Section2={{Chembox Properties

| C=7 | H=17 | N=1 | O=6 | S=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

TAPS ([tris(hydroxymethyl)methylamino]propanesulfonic acid) is a chemical compound commonly used to make buffer solutions.

It can bind divalent cations, including Co(II) and Ni(II).{{cite journal |last1=Machado |first1=Carina M. M. |last2=Gameiro |first2=Paula |last3=Soares |first3=Helena M. V. M. |journal=J. Solution Chem. |year=2008 |volume=37 |issue=5 |pages=603–617 | title= Complexation of M–(buffer)_x–(OH)_y systems involving divalent ions (cobalt or nickel) and zwitterionic biological buffers (AMPSO, DIPSO, TAPS and TAPSO) in aqueous solution |doi= 10.1007/s10953-008-9265-3|s2cid=97906177 }}

TAPS is effective to make buffer solutions in the pH range 7.7–9.1, since it has a pK_a value of 8.44 (ionic strength I = 0, 25 °C).{{cite journal |title=Thermodynamic quantities for the ionization reactions of buffers |last1=Goldberg |first1=Robert N. |first2=Nand |last2=Kishore |first3=Rebecca M. |last3=Lennen |journal=J. Phys. Chem. Ref. Data |volume=31 |issue=2 |pages=231–370 |year=2002 |url=http://structbio.vanderbilt.edu/wetlab/buffer.ioniz.pdf |doi=10.1063/1.1416902 }}

The pH (and pK_a at I ≠ 0) of the buffer solution changes with concentration and temperature, and this effect may be predicted e.g. using online calculators.{{Cite web|title=Biological buffers |url=http://www.reachdevices.com/Protein/BiologicalBuffers.html |publisher=REACH Devices}}