TC-1827
{{Chembox
| ImageFile = TC-1827.svg
| ImageSize = 200px
| ImageAlt =
| PIN = (2S,4E)-N-Methyl-5-(pyrimidin-5-yl)pent-4-en-2-amine
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 547741-76-4
| CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID = 8329797
| PubChem = 10154289
| SMILES = C[C@H](NC)C/C=C/C1=CN=CN=C1
| StdInChI=1S/C10H15N3/c1-9(11-2)4-3-5-10-6-12-8-13-7-10/h3,5-9,11H,4H2,1-2H3/b5-3+/t9-/m0/s1
| StdInChIKey = VZNTWLIIJWUCEP-SGRBOOSSSA-N
}}
|Section2={{Chembox Properties
| C=10 | H=15 | N=3
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
TC-1827 is an orally active, selective agonist of the α4β2 nicotinic receptors. Administration of TC-1827 improved memory and learning in a variety of rodents and increased long-term potentiation in hippocampal slices. In addition, the compound was without significant cardiovascular side effects, except for a small, transient rise in arterial blood pressure. The pro-cognitive effects of TC-1827 last much longer than the short half life (0.2 - 1.0 hours) would suggest.{{cite journal|last=Bohme|first=Georg Andrees|title=In vitro and in vivo characterization of TC-1827, a novel brain α4β2 nicotinic receptor agonist with pro-cognitive activity|journal=Drug Development Research|date=May 2004|volume=62|issue=1|pages=26–40|doi=10.1002/ddr.10352|s2cid=86072368}}
References
{{Reflist}}
{{Nicotinic acetylcholine receptor modulators}}