TC-N 22A

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| IUPAC_name = 4,5,6,8-Tetrahydro-N-2-pyridinylpyrazolo[3',4':6,7]cyclohepta[1,2]thiazol-2-amine

| image = TC-N_22A.svg

| width =

| tradename =

| routes_of_administration =

| CAS_number = 1314140-00-5

| UNII =

| ATC_prefix =

| PubChem = 46836562

| IUPHAR_ligand = 6231

| ChemSpiderID = 26612639

| ChEMBL = 1830707

| C=14 | H=13 | N=5 | S=1

| smiles = C2(SC(NC4=NC=CC=C4)=N3)=C3C1=CNN=C1CCC2

| StdInChI = 1S/C14H13N5S/c1-2-7-15-12(6-1)17-14-18-13-9-8-16-19-10(9)4-3-5-11(13)20-14/h1-2,6-8H,3-5H2,(H,16,19)(H,15,17,18)

| StdInChIKey = DBISXWCOHGUFSF-UHFFFAOYSA-N

}}

TC-N 22A is an experimental drug that is a positive allosteric modulator for the glutamate receptor mGluR4. It was developed as a potential medication for the treatment of Parkinson's disease, and has also been used as a lead compound for the development of further derivatives.{{cite journal | vauthors = Hong SP, Liu KG, Ma G, Sabio M, Uberti MA, Bacolod MD, Peterson J, Zou ZZ, Robichaud AJ, Doller D | title = Tricyclic thiazolopyrazole derivatives as metabotropic glutamate receptor 4 positive allosteric modulators | journal = Journal of Medicinal Chemistry | volume = 54 | issue = 14 | pages = 5070–5081 | date = July 2011 | pmid = 21688779 | doi = 10.1021/jm200290z }}{{cite journal | vauthors = Rovira X, Malhaire F, Scholler P, Rodrigo J, Gonzalez-Bulnes P, Llebaria A, Pin JP, Giraldo J, Goudet C | title = Overlapping binding sites drive allosteric agonism and positive cooperativity in type 4 metabotropic glutamate receptors | journal = FASEB Journal | volume = 29 | issue = 1 | pages = 116–130 | date = January 2015 | pmid = 25342125 | doi = 10.1096/fj.14-257287 | doi-access = free }}{{cite journal | vauthors = Wang J, Shoup T, Qu X, Kang HJ, El Fakhri G, Zhang Z, Brownell AL | title = Synthesis and evaluation of a F-18 labeled tricyclic thiazolopyrazole derivative for imaging of metabotropic glutamate receptor 4 (mGluR4). | journal = Journal of Nuclear Medicine | volume = 61 | issue = supplement 1 | pages = 1031 | date = 2020 | issn = 2159-662X }}