TES (buffer)

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 450878947

| ImageFile = TES free acid.svg

| ImageSize =

| ImageAlt =

| Name = TES

| PIN = 2-{[1,3-Dihydroxy-2-(hydroxymethyl)propan-2-yl]amino}ethane-1-sulfonic acid

| OtherNames = TES free acid

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 7365-44-8

| CASNo2 = 70331-82-7

| CASNo2_Comment = (sodium salt)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = L173DK6289

| PubChem = 6992013

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 73842

| SMILES = C(CS(=O)(=O)O)NC(CO)(CO)CO

| InChI = 1/C6H15NO6S/c8-3-6(4-9,5-10)7-1-2-14(11,12)13/h7-10H,1-5H2,(H,11,12,13)

| InChIKey = JOCBASBOOFNAJA-UHFFFAOYAR

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C6H15NO6S/c8-3-6(4-9,5-10)7-1-2-14(11,12)13/h7-10H,1-5H2,(H,11,12,13)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = JOCBASBOOFNAJA-UHFFFAOYSA-N}}

|Section2={{Chembox Properties

| Formula = C₆H₁₅NO₆S

| MolarMass = 229.25 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

TES is used to make buffer solutions. It has a pK_a value of 7.550 (I=0, 25°C).{{cite journal |title=Thermodynamic Quantities for the Ionization Reactions of Buffers |last=Goldberg |first=R. |author2=Kishore, N. |author3=Lennen, R.

|journal=J. Phys. Chem. Ref. Data |volume=31 |pages=231–370 |year=2002 |issue=2 |url=https://www.nist.gov/data/PDFfiles/jpcrd615.pdf |doi=10.1063/1.1416902

}} It is one of the Good's buffers and can be used to make buffer solutions in the pH range 6.8–8.2. It is one of the components of Test yolk buffer medium used for refrigeration and transport of semen.