TM5441

{{Short description|Chemical compound}}

{{Infobox drug

| IUPAC_name = 5-chloro-2-(2-(2-((3-(furan-3-yl)phenyl)amino)-2-oxoethoxy)acetamido)benzoic acid

| image = TM5441 structure.png

| width = 250px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_CA =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 1190221-43-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 33S35WFR9H

| ATC_prefix = None

| ATC_suffix =

| PubChem = 44250349

| ChemSpiderID = 60598824

| KEGG =

| ChEMBL = 4204253

| C=21 | H=17 | Cl=1 | N=2 | O=6

| StdInChI=1S/C21H17ClN2O6/c22-15-4-5-18(17(9-15)21(27)28)24-20(26)12-30-11-19(25)23-16-3-1-2-13(8-16)14-6-7-29-10-14/h1-10H,11-12H2,(H,23,25)(H,24,26)(H,27,28)

| StdInChIKey = BGGMLMAPVODXAU-UHFFFAOYSA-N

| SMILES = C1=CC(=CC(=C1)NC(=O)COCC(=O)NC2=C(C=C(C=C2)Cl)C(=O)O)C3=COC=C3

}}

TM5441 is a drug which acts as an inhibitor of the serpin protein plasminogen activator inhibitor-1 (PAI-1). By inhibiting PAI-1, it increases activity of the enzymes tissue plasminogen activator and urokinase, which are involved in the blood clotting cascade. It has been researched for conditions such as hepatic steatosis and diabetic nephropathy, and while it has not been developed for medical use, it is widely used in scientific research.{{cite journal | vauthors = Jeong BY, Uddin MJ, Park JH, Lee JH, Lee HB, Miyata T, Ha H | title = Novel Plasminogen Activator Inhibitor-1 Inhibitors Prevent Diabetic Kidney Injury in a Mouse Model | journal = PLOS ONE | date = 2016 | volume = 11 | issue = 6 | pages = e0157012 | doi = 10.1371/journal.pone.0157012 | pmid = 27258009 | pmc = 4892642 | bibcode = 2016PLoSO..1157012J | doi-access = free }}{{cite journal | vauthors = Eren M, Place AT, Thomas PM, Flevaris P, Miyata T, Vaughan DE | title = PAI-1 is a critical regulator of FGF23 homeostasis | journal = Science Advances | volume = 3 | issue = 9 | pages = e1603259 | date = September 2017 | doi = 10.1126/sciadv.1603259 | pmid = 28924605 | pmc = 5597312 | bibcode = 2017SciA....3E3259E | s2cid = 13059562 | doi-access = free }}{{cite journal | vauthors = Hosaka S, Yamada T, Takahashi K, Dan T, Kaneko K, Kodama S, Asai Y, Munakata Y, Endo A, Sugawara H, Kawana Y, Yamamoto J, Izumi T, Sawada S, Imai J, Miyata T, Katagiri H | display-authors = 6 | title = Inhibition of Plasminogen Activator Inhibitor-1 Activation Suppresses High Fat Diet-Induced Weight Gain via Alleviation of Hypothalamic Leptin Resistance | journal = Frontiers in Pharmacology | date = 2020 | volume = 11 | pages = 943 | doi = 10.3389/fphar.2020.00943 | pmid = 32670063 | pmc = 7327106 | doi-access = free }}{{cite journal | vauthors = Kuru Bektaşoğlu P, Koyuncuoğlu T, Akbulut S, Akakın D, Eyüboğlu İP, Erzik C, Yüksel M, Kurtel H | display-authors = 6 | title = Neuroprotective Effect of Plasminogen Activator Inhibitor-1 Antagonist in the Rat Model of Mild Traumatic Brain Injury | journal = Inflammation | volume = 44 | issue = 6 | pages = 2499–2517 | date = December 2021 | doi = 10.1007/s10753-021-01520-0 | pmid = 34460025 | s2cid = 236584848 | url = https://www.researchsquare.com/article/rs-479179/latest.pdf }}

References