TMC-647055
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 28-cyclohexyl-22-methoxy-10,16-dimethyl-9,9-dioxo-13-oxa-9λ6-thia-1,8,10,16-tetrazapentacyclo[16.8.1.12,6.13,26.020,25]nonacosa-2,4,6(29),18,20(25),21,23,26(28)-octaene-7,17-dione
| image = TMC-647055.svg
| tradename =
| legal_US = Investigational drug
| legal_status =
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 1204416-97-6
| PubChem = 44556044
| UNII = 11BD024G7J
| ChemSpiderID = 28522119
| ChEMBL = 2043025
| DrugBank = DB11822
| C=32 | H=38 | N=4 | O=6 | S=1
| SMILES = CN1CCOCCN(S(=O)(=O)NC(=O)C2=CC3=C(C=C2)C(=C4N3CC(=CC5=C4C=CC(=C5)OC)C1=O)C6CCCCC6)C
| StdInChI=1S/C32H38N4O6S/c1-34-13-15-42-16-14-35(2)43(39,40)33-31(37)22-9-11-27-28(19-22)36-20-24(32(34)38)17-23-18-25(41-3)10-12-26(23)30(36)29(27)21-7-5-4-6-8-21/h9-12,17-19,21H,4-8,13-16,20H2,1-3H3,(H,33,37)
| StdInChIKey = UOBYJVFBFSLCTQ-UHFFFAOYSA-N
}}
TMC-647055 is an experimental antiviral drug which was developed as a treatment for hepatitis C, and is in clinical trials as a combination treatment with ribavirin and simeprevir. It acts as a NS5b polymerase inhibitor.{{cite journal | vauthors = Vendeville S, Lin TI, Hu L, Tahri A, McGowan D, Cummings MD, Amssoms K, Canard M, Last S, Van den Steen I, Devogelaere B, Rouan MC, Vijgen L, Berke JM, Dehertogh P, Fransen E, Cleiren E, van der Helm L, Fanning G, Van Emelen K, Nyanguile O, Simmen K, Raboisson P | display-authors = 6 | title = Finger loop inhibitors of the HCV NS5b polymerase. Part II. Optimization of tetracyclic indole-based macrocycle leading to the discovery of TMC647055 | journal = Bioorganic & Medicinal Chemistry Letters | volume = 22 | issue = 13 | pages = 4437–43 | date = July 2012 | pmid = 22633687 | doi = 10.1016/j.bmcl.2012.04.113 }}{{cite journal | vauthors = Cummings MD, Lin TI, Hu L, Tahri A, McGowan D, Amssoms K, Last S, Devogelaere B, Rouan MC, Vijgen L, Berke JM, Dehertogh P, Fransen E, Cleiren E, van der Helm L, Fanning G, Nyanguile O, Simmen K, Van Remoortere P, Raboisson P, Vendeville S | display-authors = 6 | title = Discovery and early development of TMC647055, a non-nucleoside inhibitor of the hepatitis C virus NS5B polymerase | journal = Journal of Medicinal Chemistry | volume = 57 | issue = 5 | pages = 1880–92 | date = March 2014 | pmid = 24144360 | doi = 10.1021/jm401396p }}{{cite journal | vauthors = Bourgeois S, Van Vlierberghe H, Moreno C, Orlent H, Nevens F, Arastéh K, Horsmans Y, Schattenberg JM, Buggisch P, Francque S, Vijgen L, Kakuda TN, Hoeben E, Luo D, Vandebosch A, Jacquemyn B, Van Remoortere P, Verloes R | display-authors = 6 | title = Efficacy, safety and pharmacokinetics of simeprevir and TMC647055/ritonavir with or without ribavirin and JNJ-56914845 in HCV genotype 1 infection | journal = BMC Gastroenterology | volume = 17 | issue = 1 | pages = 26 | date = February 2017 | pmid = 28187751 | pmc = 5303260 | doi = 10.1186/s12876-017-0580-2 | doi-access = free }}
References
{{Reflist}}
{{RNA antivirals}}
{{antiinfective-drug-stub}}