Talaporfin

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 447519392

| IUPAC_name = N-{[(2S,3S)-7-carboxy-3-(2-carboxyethyl)-12-ethyl-2,8,13,18-tetramethyl-17-vinyl-2,3-dihydroporphyrin-5-yl]acetyl}-L-aspartic acid

| image = Talaporfin.png

| tradename =

| Drugs.com = {{drugs.com|international|talaporfin}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration = IV

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 110230-98-3

| CAS_supplemental =
{{CAS|220201-34-3}} (sodium salt)

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 5486799

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = P4ROX5ELT2

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 16737134

| chemical_formula =

| C=38 | H=41 | N=5 | O=9

| smiles = CCC1=C2C=C3C(=C(C(=N3)C(=C4[C@H]([C@@H](C(=N4)C=C5C(=C(C(=CC(=C1C)N2)N5)C=C)C)C)CCC(=O)O)CC(=O)N[C@@H](CC(=O)O)C(=O)O)C(=O)O)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C38H41N5O9/c1-7-20-16(3)24-12-26-18(5)22(9-10-32(45)46)35(42-26)23(11-31(44)41-30(37(49)50)15-33(47)48)36-34(38(51)52)19(6)27(43-36)14-29-21(8-2)17(4)25(40-29)13-28(20)39-24/h7,12-14,18,22,30,39,43H,1,8-11,15H2,2-6H3,(H,41,44)(H,45,46)(H,47,48)(H,49,50)(H,51,52)/b24-12-,25-13-,26-12-,27-14-,28-13-,29-14-,35-23-,36-23-/t18-,22-,30-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = VSEIDZLLWQQJGK-WSUYNKMOSA-N

}}

Talaporfin (INN, also known as aspartyl chlorin, mono-L-aspartyl chlorin e6, NPe6, or LS11) is a chlorin based photosensitizer used in photodynamic therapy (PDT).

It absorbs red light at 664-667 nm normally provided by a laser tuned to this wavelength.{{cite journal | vauthors = Usuda J, Kato H, Okunaka T, Furukawa K, Tsutsui H, Yamada K, Suga Y, Honda H, Nagatsuka Y, Ohira T, Tsuboi M, Hirano T | title = Photodynamic therapy (PDT) for lung cancers | journal = Journal of Thoracic Oncology| volume = 1 | issue = 5 | pages = 489–93 | date = June 2006 | pmid = 17409904 | doi = 10.1016/S1556-0864(15)31616-6 | doi-access = | s2cid = 19722977 }}

It was approved in Japan (in 2004) for PDT of lung cancer and marketed as Laserphyrin.{{cite journal | vauthors = Usuda J, Kato H, Okunaka T, Furukawa K, Honda H, Suga Y, Hirata T, Ohira T, Tsuboi M, Hirano T | title = Photodynamic therapy using Laserphyrin for centrally located early stage lung cancer. | journal = Journal of Clinical Oncology | date = June 2006 | volume = 24 | issue = 18 suppl | pages = 7229 | doi = 10.1200/jco.2006.24.18_suppl.7229 | url = http://meeting.ascopubs.org/cgi/content/abstract/24/18_suppl/7229 | url-access = subscription }}