Taleranol

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (7S,11S)-7,15,17-Trihydroxy-11-methyl-12-oxabicyclo[12.4.0]octadeca-1(14),15,17-trien-13-one

| image = Taleranol.svg

| width = 250

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 42422-68-4

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 65434

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID =

| UNII = HUN219N434

| KEGG =

| ChEBI = 35071

| ChEMBL = 491510

| C=18 | H=26 | O=5

| SMILES = C[C@H]1CCC[C@@H](O)CCCCCc2cc(O)cc(O)c2C(=O)O1

| StdInChI_Ref =

| StdInChI = 1S/C18H26O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h10-12,14,19-21H,2-9H2,1H3/t12-,14-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = DWTTZBARDOXEAM-JSGCOSHPSA-N

| synonyms = P-1560; Teranol; β-Zearalanol

}}

Taleranol (INN, USAN) (developmental code name P-1560), or teranol, also known as β-zearalanol, is a synthetic, nonsteroidal estrogen of the resorcylic acid lactone group related to mycoestrogens found in Fusarium spp which was never marketed.{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA350|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=350–}}{{cite book| vauthors = Yildiz F |title=Advances in Food Biochemistry|url=https://books.google.com/books?id=orwY4Nd_t1wC&pg=PA233|date=16 December 2009|publisher=CRC Press|isbn=978-1-4200-0769-5|pages=233–}} It is the β epimer of zeranol (α-zearalanol) and is a major metabolite of zeranol but with less biological activity.{{cite book| vauthors = Yu L, Wang S, Sun BG |title=Food Safety Chemistry: Toxicant Occurrence, Analysis and Mitigation|url=https://books.google.com/books?id=rs3MBQAAQBAJ&pg=PA240|date=28 October 2014|publisher=CRC Press|isbn=978-1-4665-9795-2|pages=240–}}