Talnetant

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 448116057

| IUPAC_name = 3-hydroxy-2-phenyl-N-(1-phenylpropyl)quinoline-4-carboxamide

| image = Talnetant.png

| width = 220

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| bioavailability =

| protein_bound =

| metabolism =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 174636-32-9

| CAS_supplemental =

| ATC_prefix = none

| ATC_suffix =

| PubChem = 133090

| IUPHAR_ligand = 2124

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = CZ3T9T146K

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 117450

| C=25 | H=22 | N=2 | O=2

| smiles = CCC(C1=CC=CC=C1)NC(=O)C2=C(C(=NC3=CC=CC=C32)C4=CC=CC=C4)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C25H22N2O2/c1-2-20(17-11-5-3-6-12-17)27-25(29)22-19-15-9-10-16-21(19)26-23(24(22)28)18-13-7-4-8-14-18/h3-16,20,28H,2H2,1H3,(H,27,29)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = BIAVGWDGIJKWRM-UHFFFAOYSA-N

}}

Talnetant (SB-223,412) is a neurokinin 3 receptor antagonist developed by GlaxoSmithKline, which is being researched for several functions (primarily treatment of irritable bowel syndrome, despite a 2007 study finding no statistically significant improvement in rectal hypersensitivity over placebo). Its use as a potential antipsychotic drug for the treatment of schizophrenia has also been discontinued.{{cite web|title=UPDATE 1-GlaxoSmithKline prunes new drug pipeline|url=https://www.reuters.com/article/glaxo-pipeline-idUSL152723420071015|publisher=Reuters|date= Oct 15, 2007}}{{cite journal | vauthors = Evangelista S | title = Talnetant GlaxoSmithKline | journal = Current Opinion in Investigational Drugs | volume = 6 | issue = 7 | pages = 717–21 | date = July 2005 | pmid = 16044668 }}{{cite journal | vauthors = Houghton LA, Cremonini F, Camilleri M, Busciglio I, Fell C, Cox V, Alpers DH, Dewit OE, Dukes GE, Gray E, Lea R, Zinsmeister AR, Whorwell PJ | display-authors = 6 | title = Effect of the NK(3) receptor antagonist, talnetant, on rectal sensory function and compliance in healthy humans | journal = Neurogastroenterology and Motility | volume = 19 | issue = 9 | pages = 732–43 | date = September 2007 | pmid = 17727393 | doi = 10.1111/j.1365-2982.2007.00934.x | s2cid = 11876042 }}{{cite journal | vauthors = Dawson LA, Cato KJ, Scott C, Watson JM, Wood MD, Foxton R, de la Flor R, Jones GA, Kew JN, Cluderay JE, Southam E, Murkitt GS, Gartlon J, Pemberton DJ, Jones DN, Davies CH, Hagan J | display-authors = 6 | title = In vitro and in vivo characterization of the non-peptide NK3 receptor antagonist SB-223412 (talnetant): potential therapeutic utility in the treatment of schizophrenia | journal = Neuropsychopharmacology | volume = 33 | issue = 7 | pages = 1642–52 | date = June 2008 | pmid = 17728699 | doi = 10.1038/sj.npp.1301549 | doi-access = free }}

See also

References

{{reflist}}

{{Neurokinin receptor modulators}}

Category:Antipsychotics

Category:NK3 receptor antagonists

Category:Quinolinols

Category:Carboxamides

{{pharma-stub}}