Taribavirin

{{short description|Antiviral drug}}

{{distinguish|text=tribavirin, which is ribavirin}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470477612

| IUPAC_name = 1-[(2R,3R,4S,5R)- 3,4-dihydroxy-5- (hydroxymethyl)oxolan-2-yl]- 1,2,4-triazole-3-carboximidamide

| image = Taribavirin.svg

| width = 175

| image2 = Taribavirin 3D spacefill.png

| width2 = 215

| alt2 = Ball-and-stick model of the taribavirin molecule

| tradename =

| pregnancy_category = X

| legal_status = In Phase III drug trials

| routes_of_administration = Oral capsules)

| bioavailability = 9%

| metabolism = Metabolized to 5'phosphates, de-riboside, and deriboside carboxylic acid

| elimination_half-life = 12 days - Multiple Dose; 120-170 hours - Single Dose

| excretion = 10% fecal, remainder in urine (30% unchanged, remainder metabolites)

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 119567-79-2

| ATC_prefix = J05

| ATC_suffix = AB04

| PubChem = 451448

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = none

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 397669

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = R3B1994K2E

| NIAID_ChemDB = 000198

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = D06651

| C=8 | H=13 | N=5 | O=4

| SMILES = n1c(nn(c1)[C@@H]2O[C@@H]([C@@H](O)[C@H]2O)CO)C(=[N@H])N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C8H13N5O4/c9-6(10)7-11-2-13(12-7)8-5(16)4(15)3(1-14)17-8/h2-5,8,14-16H,1H2,(H3,9,10)/t3-,4-,5-,8-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NHKZSTHOYNWEEZ-AFCXAGJDSA-N

| synonyms = 1-(β-D-Ribofuranosyl)-
1,2,4-triazole-3-carboximide

}}

Taribavirin (rINN; also known as viramidine, codenamed ICN 3142) is an antiviral drug in Phase III human trials, but not yet approved for pharmaceutical use. It is a prodrug of ribavirin, active against a number of DNA and RNA viruses. Taribavirin has better liver-targeting than ribavirin, and has a shorter life in the body due to less penetration and storage in red blood cells. It is expected eventually to be the drug of choice for viral hepatitis syndromes in which ribavirin is active. These include hepatitis C and perhaps also hepatitis B and yellow fever.