Tebupirimfos

{{Chembox

| ImageFile =Tebupirimfos structure.svg

| ImageAlt =

| ImageName =

| PIN =O-(2-tert-Butylpyrimidin-5-yl) O-ethyl O-(propan-2-yl) phosphorothioate

| OtherNames =Tebupirimphos; Phostebupirim; MAT 7484; BAY-MAT 7484; HSDB 7136; Aztec

|Section1={{Chembox Identifiers

| 3DMet =

| Abbreviations =

| Beilstein =

| CASNo =96182-53-5

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNoOther =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = P036T39NSI

| ChEBI =

| ChemSpiderID =84419

| DrugBank =

| EC_number =

| EINECS =

| Gmelin =

| InChI =1S/C13H23N2O3PS/c1-7-16-19(20,17-10(2)3)18-11-8-14-12(15-9-11)13(4,5)6/h8-10H,7H2,1-6H3

| KEGG =

| MeSHName =

| PubChem =93516

| RTECS =

| SMILES = S=P(OC(C)C)(OCC)OC1=CN=C(C(C)(C)C)N=C1

| UNNumber =UN2810

}}

|Section2={{Chembox Properties

| AtmosphericOHRateConstant =

| Appearance =Amber to brown liquid{{PubChem|93516}}

| BoilingPtC = 135

| BoilingPt_notes =1.5 mmHg{{cite web | url=http://chemservice.com/media/product/msds/N-13503.pdf | title=MSDS via Chem Service Inc. | access-date=January 12, 2013}}

| Density =1.146 g/cm³

| C=13 | H=23 | N=2 | O=3 | P=1 | S=1

| HenryConstant =

| LogP =

| MeltingPt =

| MeltingPt_notes =

| pKa =

| pKb =

| Solubility =

| SolubleOther =

| Solvent =

| VaporPressure =}}

|Section3={{Chembox Structure

| Coordination =

| CrystalStruct =

| MolShape = }}

|Section4={{Chembox Thermochemistry

| DeltaHc =

| DeltaHf =

| Entropy =

| HeatCapacity = }}

|Section5={{Chembox Pharmacology

| AdminRoutes =

| Bioavail =

| Excretion =

| HalfLife =

| Metabolism =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

| Pregnancy_US =

| ProteinBound = }}

|Section6={{Chembox Explosive

| DetonationV =

| FrictionSens =

| REFactor =

| ShockSens = }}

|Section7={{Chembox Hazards

| AutoignitionPtC =

| ExploLimits =

| ExternalSDS =

| FlashPtC = 93

| LD50 =

| MainHazards =

| NFPA-H =4

| NFPA-F =1

| NFPA-R =1

| NFPA-S =

| PEL =

| HPhrases =

| PPhrases =

| GHS_ref =

}}

|Section8={{Chembox Related

| OtherFunction_label = insecticide

| OtherAnions =

| OtherCations =

| OtherCompounds =

| OtherFunction = }}

}}

Tebupirimfos, also known as phostebupirim, is an organothiophosphate insecticide. It is used on corn crops, including popcorn.{{cite web | url=https://docs.google.com/viewer?a=v&q=cache:puia407qlioJ:www.epa.gov/oppsrrd1/REDs/phostebupirim_red.pdf+&hl=en&gl=us&pid=bl&srcid=ADGEESj-u2ZgQsK_2vyU3_-28uX1YQrZexyt_rxU4oPEVXO_MdGYJ3SbFzBcJp4QdFQyKmfmLB8_Zg_YYiD0Z_4U-d0zcPfdj-HYzh9aUxSL9hIG04cLHw6BuNuokWRqDiEYF39zLMmR&sig=AHIEtbQDI3J32jleRE7XMM6Q_yGwoIR7_w | title=US Environmental Protection Agency Office of Pesticide Programs Reregistration Eligibility Decision for Phostebupirim | publisher=United States EPA | date=July 31, 2006 | access-date=January 11, 2013 | author=Edwards, Debra}}{{cite web | url=https://docs.google.com/viewer?a=v&q=cache:svSYlXz01EcJ:www.epa.gov/oppsrrd1/REDs/factsheets/phostredfact.pdf+&hl=en&gl=us&pid=bl&srcid=ADGEESiqTUipefcty0lTEmJaREehETIAfQw_iAmVrGQ_9GNof8tj4quJ29uVAoKvyqdrfau3mrK7IYV9eDPm4oZf9b8oR2Z_-tvBA1y64386fryJ9Gf7LCwvJNDdE41iVnt5cFmn99Wy&sig=AHIEtbSpEAYRqKJw0aux3RunUVf47u5jxA | title=US EPA Phostebupirim Facts | publisher=United States EPA | date=September 2000 | access-date=January 11, 2013}}