Technetium (99mTc) exametazime

{{Short description|Chemical compound}}

{{DISPLAYTITLE:Technetium (^99mTc) exametazime}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 448093582

| IUPAC_name = {{!(}}{{!(}}(3RS,3{{'}}RS)-3,3'-{{!(}}(2,2-Dimethyltrimethylene)diimino{{)!}}{{!(}}di-2-butanone{{)!}}dioximato{{)!}}(^3–)-N,N{{'}},N{{'}}{{'}},N{{'}}{{'}}{{'}}{{)!}}oxotechnetium (^99mTc)

| image = Tc-99m exametazime skeletal.svg

| drug_name = Technetium (^99mTc) exametazime

| tradename = Medi-Exametazim

| licence_US = Ceretec

| pregnancy_AU =

| pregnancy_US = C

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US = Rx-only

| legal_status =

| routes_of_administration = Intravenous

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|CAS}}

| CAS_number = 99944-78-2

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 3B744AG22N

| ATC_prefix = V09

| ATC_suffix = AA01

| ATC_supplemental =
{{ATC|V09|HA02}} (labelled leucocytes)

| PubChem = 9552069

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| C=13 | H=25 | N=4 | O=3 | Tc=1

| chirality = racemic

| SMILES = CC1(C)CN2[Tc]3(N4C1)([N](O[H]O[N]3=C(C)[C@H]4C)=C(C)[C@H]2C)=O

| SMILES2 = CC1(C)CN2[Tc]3(N4C1)([N](O[H]O[N]3=C(C)[C@@H]4C)=C(C)[C@@H]2C)=O

}}

Technetium (^99mTc) exametazime is a radiopharmaceutical sold under the trade name Ceretec, and is used by nuclear medicine physicians for the detection of altered regional cerebral perfusion in stroke{{cite journal | vauthors = Moretti JL, Defer G, Cinotti L, Cesaro P, Degos JD, Vigneron N, Ducassou D, Holman BL | display-authors = 6 | title = "Luxury perfusion" with 99mTc-HMPAO and 123I-IMP SPECT imaging during the subacute phase of stroke | journal = European Journal of Nuclear Medicine | volume = 16 | issue = 1 | pages = 17–22 | year = 1990 | pmid = 2307169 | doi = 10.1007/BF01566007 | s2cid = 11934803 }} and other cerebrovascular diseases. It can also be used for the labelling of leukocytes to localise intra-abdominal infections{{cite journal | vauthors = Weldon MJ, Joseph AE, French A, Saverymuttu SH, Maxwell JD | title = Comparison of 99m technetium hexamethylpropylene-amine oxime labelled leucocyte with 111-indium tropolonate labelled granulocyte scanning and ultrasound in the diagnosis of intra-abdominal abscess | journal = Gut | volume = 37 | issue = 4 | pages = 557–64 | date = October 1995 | pmid = 7489945 | pmc = 1382910 | doi = 10.1136/gut.37.4.557 }} and inflammatory bowel disease.{{cite journal | vauthors = Ui K, Yamaguchi T | title = [Therapy and diagnosis of emergency shock patients] | journal = Nihon Naika Gakkai Zasshi. The Journal of the Japanese Society of Internal Medicine | volume = 80 | issue = 12 | pages = 1892–6 | date = December 1991 | doi = 10.2169/naika.80.1892 | pmid = 1804909 | doi-access = free }} Exametazime (the part without technetium) is sometimes referred to as hexamethylpropylene amine oxime or HMPAO, although correct chemical names are:{{cite web |title=Exametazime |url=https://pubchem.ncbi.nlm.nih.gov/compound/9552071#section=Deprecated-CAS |website=PubChem|publisher=National Institutes of Health}}

• (NE)-N-[(3R)-3-[[3-[[(2R,3E)-3-hydroxyiminobutan-2-yl]amino]-2,2-dimethylpropyl]amino]butan-2-ylidene]hydroxylamine
• or 3,3'-((2,2,-dimethyl-1,3-propanediyl)diimino)bis-2-butanone dioxime.