Temoporfin

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 448134770

| IUPAC_name = 3,3',3,3'-(2,3-dihydroporphyrin-5,10,15,20-tetrayl)tetraphenol

| image = Temoporfin.png

| tradename =

| Drugs.com = {{drugs.com|international|temoporfin}}

| licence_EU = yes

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 122341-38-2

| ATC_prefix = L01

| ATC_suffix = XD05

| ATC_supplemental =

| PubChem = 60751

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL = 383675

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = FU21S769PF

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D06066

| ChemSpiderID = 54754

| chemical_formula =

| C=44 | H=32 | N=4 | O=4

| smiles = C1CC2=NC1=C(C3=CC=C(N3)C(=C4C=CC(=N4)C(=C5C=CC(=C2C6=CC(=CC=C6)O)N5)C7=CC(=CC=C7)O)C8=CC(=CC=C8)O)C9=CC(=CC=C9)O

| StdInChI = 1S/C44H32N4O4/c49-29-9-1-5-25(21-29)41-33-13-15-35(45-33)42(26-6-2-10-30(50)22-26)37-17-19-39(47-37)44(28-8-4-12-32(52)24-28)40-20-18-38(48-40)43(36-16-14-34(41)46-36)27-7-3-11-31(51)23-27/h1-17,19,21-24,46-47,49-52H,18,20H2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-

| StdInChIKey = LYPFDBRUNKHDGX-LWQDQPMZSA-N

}}

Temoporfin (INN) is a photosensitizer (based on chlorin) used in photodynamic therapy for the treatment of squamous cell carcinoma of the head and neck.{{cite journal | vauthors = Lorenz KJ, Maier H | title = [Squamous cell carcinoma of the head and neck. Photodynamic therapy with Foscan] | language = de | journal = Hno | volume = 56 | issue = 4 | pages = 402–409 | date = April 2008 | pmid = 17516041 | doi = 10.1007/s00106-007-1573-1 }}{{cite journal | vauthors = O'Connor AE, Gallagher WM, Byrne AT | title = Porphyrin and nonporphyrin photosensitizers in oncology: preclinical and clinical advances in photodynamic therapy | journal = Photochemistry and Photobiology | volume = 85 | issue = 5 | pages = 1053–1074 | year = 2009 | doi = 10.1111/j.1751-1097.2009.00585.x | pmid = 19682322 | s2cid = 205950773 | doi-access = free }}

It is marketed in the European Union under the brand name Foscan. The U.S. Food and Drug Administration (FDA) declined to approve Foscan in 2000. The EU approved its use in June 2001.{{cite web | url = http://www.highbeam.com/doc/1P2-18794532.html | work = HighBeam | title = Foscan approval saves Scotia's skin. | archive-url = https://web.archive.org/web/20121104175701/http://www.highbeam.com/doc/1P2-18794532.html | archive-date = 2012-11-04 }}

Good results were obtained in 21 of 35 patients treated in Germany.{{cite journal | vauthors = Lorenz KJ, Maier H | title = Photodynamic therapy with meta-tetrahydroxyphenylchlorin (Foscan) in the management of squamous cell carcinoma of the head and neck: experience with 35 patients | journal = European Archives of Oto-Rhino-Laryngology | volume = 266 | issue = 12 | pages = 1937–1944 | date = December 2009 | pmid = 19290535 | doi = 10.1007/s00405-009-0947-2 | s2cid = 5892034 }}

It is photoactivated at 652 nm by red light.

Patients can remain photosensitive for several weeks after treatment.