Template:Infobox drug/testcases2#Licence

{{testcase table

| qid=Q130365

| DTXSID = DTXSID8021777

| DTXSID2 = DTXSID8021777

| drug_name = Riboflavin

| IUPAC_name = 7,8-Dimethyl-10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]benzo[g]pteridine-2,4-dione

| image =

| width =

| alt =

| image2 = Riboflavin-3d-balls.png

| width2 =

| alt2 =

| caption = Chemical structure

| pronounce =

| tradename = Many{{cite web | title=Riboflavin | website=Drugs.com | date=22 July 2021 | url=https://www.drugs.com/monograph/riboflavin.html | access-date=8 October 2021}}

| Drugs.com = {{Drugs.com|monograph|Riboflavin}}

| MedlinePlus =

| licence_EU =

| DailyMedID = Riboflavin

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_US = A

| pregnancy_US_comment = and C

| pregnancy_category=

| dependency_liability =

| addiction_liability =

| routes_of_administration = By mouth, intramuscular, intravenous

| ATC_prefix = A11

| ATC_suffix = HA04

| ATC_supplemental = {{ATC|S01|XA26}}

| legal_US_comment = Dietary supplement

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life = 66 to 84 minutes

| duration_of_action =

| excretion = Urine

| CAS_number = 83-88-5

| CAS_supplemental = {{cascite|correct|CAS}}

| PubChem = 493570

| PubChemSubstance =

| IUPHAR_ligand = 6578

| DrugBank = DB00140

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID = 431981

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| UNII = TLM2976OFR

| KEGG = D00050

| KEGG_Ref = {{keggcite|correct|kegg}}

| ChEBI = 17015

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1534

| ChEMBL_Ref = {{ebicite|correct|EMBL}}

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = lactochrome, lactoflavin, vitamin G

| C=17 | H=20 | N=4 | O=6

| SMILES = c12cc(C)c(C)cc1N=C3C(=O)NC(=O)N=C3N2C[C@H](O)[C@H](O)[C@H](O)CO

| StdInChI = InChI=1S/C17H20N4O6/c1-7-3-9-10(4-8(7)2)21(5-11(23)14(25)12(24)6-22)15-13(18-9)16(26)20-17(27)19-15/h3-4,11-12,14,22-25H,5-6H2,1-2H3,(H,20,26,27)/t11-,12+,14-/m0/s1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AUNGANRZJHBGPY-SCRDCRAPSA-N

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

}}

• {{t links|sandboxlinks=yes|Infobox drug/licence}}

:{{tl|Infobox drug}}

:{{tl|Infobox drug/licence}}

{{testcase table

| name = namehere

| INN = Linezolid

}}

:Tegafur/gimeracil/oteracil (~random)

{{testcase table

| drug_name =

| type = combo

| image =

| width =

| alt =

| image2 =

| width2 =

| alt2 =

| caption =

| component1 = Tegafur

| class1 = Antineoplastic drug

| component2 = Gimeracil

| class2 = Enzyme inhibitor

| component3 = Oteracil

| class3 = Enzyme inhibitor

| pronounce =

| tradename = Teysuno, TS-1

| Drugs.com = {{Drugs.com|UK|Teysuno}}

| MedlinePlus =

| licence_EU = yes

| INN_EMA = Tegafur

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_US =

| pregnancy_US_comment =

| pregnancy_category= Contraindicated

| dependency_liability =

| addiction_liability =

| routes_of_administration = By mouth

| ATCvet =

| ATC_prefix = L01

| ATC_suffix = BC53

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK = POM

| legal_UK_comment = {{cite web | title=Teysuno 20mg/5.8mg/15.8mg hard capsules - Summary of Product Characteristics (SmPC) | website=(emc) | url=https://www.medicines.org.uk/emc/product/3999/smpc | access-date=30 July 2020}}

| legal_US =

| legal_US_comment =

| legal_EU = Rx-only

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status = Rx-only

| CAS_number_Ref =

| CAS_number = 150863-82-4

| CAS_supplemental =

| PubChem = 54715158

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID =

| UNII_Ref =

| UNII =

| KEGG_Ref =

| KEGG =

| ChEBI_Ref =

| ChEBI =

| ChEMBL_Ref =

| ChEMBL =

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = S-1{{cite journal |vauthors=Liu TW, Chen LT |title=S-1 with leucovorin for gastric cancer: how far can it go? |journal=Lancet Oncol. |volume= 17|pages= 12–4|year=201 |issue=1 |pmid=26640038 |doi=10.1016/S1470-2045(15)00478-7 }}

}}

{{purge}}

{{testcase table

| name = {{PAGENAME}}

| INN = Linezolid

| Verifiedfields = changed

| verifiedrevid = 415028406

| IUPAC_name = (S)-N-({3-[3-fluoro-4-(morpholin-4-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl}methyl)acetamide

| image = Linezolid.svg

| alt = Skeletal formula of linezolid

| image2 = Linezolid-from-xtal-2008-3D-balls.png

| pronounce = {{IPAc-en|nj|uː|ˈ|m|əʊ|n|i|ə}}

| tradename = Linospan, Zyvox, Zyvoxam, Zyvoxid

| Drugs.com = {{drugs.com|monograph|linezolid}}

| MedlinePlus = a602004

| licence_CA = Linezolid

| licence_EU = Linezolid

| DailyMedID = Linezolid

| licence_US = Linezolid

| pregnancy_US = C

| pregnancy_AU = C

| legal_status_AU = S4

| legal_status_UK = POM

| legal_status_US = ℞-only

| routes_of_administration = Intravenous infusion, oral

| dependency_liability = High

| addiction_liability = Low

| metabolites = some stuff

| duration_of_action= 1 to 3 hr

| bioavailability = ~100% (oral)

| protein_bound = Low (31%)

| metabolism = Hepatic (50–70%, CYP not involved)

| elimination_half-life = 4.2–5.4 hours (shorter in children)

| excretion = Nonrenal, renal, and fecal

| onset = 1 hr

| synonyms = Lenzomore

| CASNo_Ref = {{cascite|correct|CAS}}

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 165800-03-3

| ATC_prefix = J01

| ATC_suffix = XX08

| PubChem = 441401

| DrugBank_Ref =

| DrugBank = DB00601

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 390139

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = ISQ9I6J12J

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00947

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 126

| NIAID_ChemDB = 070944

| PDB_ligand = ZLD

| IUPHAR_ligand = 1234

| C=16 | H=20 | F=1 | N=3 | O=4

| molecular_weight = 337.346 g/mol

| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3

| InChI = 1/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = TYZROVQLWOKYKF-ZDUSSCGKSA-N

| density = 1.40

| melting_point = 135

| boiling_point = 140

| boiling_notes = (decomposes)

| solubility = 3}}

{{purge}}

: See also WP:ENGVAR: english language variant of the article

:In {{tlf|Infobox drug}}: spelling of licence/license. Default is to be en-US: License.

: Use parameter {{para|engvar}} for non-default spelling:

;Default {{red|licenSe}} {{nobold|1=(US)}}

{{testcase table

| drug_name=demo

| licence_US = C

| licence_UK = OTC

}}

;{{para|engvar|en-US}} {{red|licenSe}}

{{testcase table

| drug_name=demo

| engvar=en-US

| licence_CA = Linezolid

| licence_EU = Linezolid

| DailyMedID = Linezolid

| licence_US = Linezolid

}}

;{{para|engvar|en-UK}} {{red|licenCe}}

{{testcase table

| drug_name=demo

| engvar=en-UK

| licence_CA = Linezolid

| licence_EU = Linezolid

| DailyMedID = Linezolid

| licence_US = Linezolid

}}

;{{para|engvar|en-NZ}} {{red|licenCe}}

{{testcase table

| drug_name=demo

| engvar=en-NZ

| licence_CA = Linezolid

| licence_EU = Linezolid

| DailyMedID = Linezolid

| licence_US = Linezolid

}}

{{Purge}} Reduced infobox.

:Current infobox title: {{strong|1=Lysergic acid diethylamide}} (pagename, not INN)

:New situation would be (adding "(LSD)" is just a liberty I took, to help our readers):

{{Testcase table

| drug_name=Lysergic acid diethylamide (LSD)

| INN = Lysergide

| IUPAC_name = (6aR,9R)-N,N-diethyl-7-methyl-4,6,6a,7,8,9-hexahydroindolo-[4,3-fg]quinoline-9-carboxamide

| image = LSD-2D-skeletal-formula-and-3D-models.png

| pregnancy_US = C

| legal_AU = Schedule 9

| legal_CA = Schedule III

| legal_NZ = Class A

| legal_UK = Class A

| legal_UN = P I

| legal_US = Schedule I

| legal_DE = Anlage I

| addiction_liability = None

| dependency_liability = Low

| routes_of_administration = Oral, etc

| metabolism = Hepatic

| elimination_half-life = 3–5 hours

| excretion = Renal

| CAS_number = 50-37-3

| ChEBI = 6605

| PubChem = 5761

| IUPHAR_ligand = 17

| DrugBank = DB04829

| ChemSpiderID = 5558

| UNII = 8NA5SWF92O

| ChEMBL = 263881

| ATC_prefix = none

| C=20 | H=25 | N=3 | O=1

| synonyms = Acid, LSD, lysergide

}}

• alpha-Methyltryptamine

: No need to use {{para|INN}}. Note the titletext (mousehover).

{{Testcase table

| IUPAC_name = 2-(1H-indol-3-yl)-1-methyl-ethylamine

| image = AMT.svg

| width = 150px

| drug_name = α-Methyltryptamine

| routes_of_administration = Oral

| CAS_number = 299-26-3

| ATC_prefix = none

| ATC_suffix =

| C=11 | H=14 | N=2

| synonyms = Indopan; IT-290, IT-403, U-14,164E, 3-IT

}}

{{testcase table

| CAS_number = 1234-56-7

| trade_names=no dn

}}

{{testcase table

| drug_name =

| CAS_number = 1234-56-7

| trade_names=blank dn

}}

{{testcase table

| drug_name = Infobox drug/testcases8

| CAS_number = 1234-56-7

| trade_names = dn=pagenm

}}

{{testcase table

| drug_name = Aspirin

| CAS_number = 1234-56-7

| trade_names=dn is diff

}}

{{testcase table

| CAS_number = 1234-56-7

| trade_names=no dn

| INN = inn

}}

{{testcase table

| drug_name =

| CAS_number = 1234-56-7

| trade_names=blank dn

| INN = inn

}}

{{testcase table

| drug_name = Infobox drug/testcases8

| CAS_number = 1234-56-7

| trade_names = dn=pagenm

| INN = inn

}}

{{testcase table

| drug_name = Aspirin MP

| CAS_number = 1234-56-7

| trade_names=dn is diff

| INN = inn

}}

;blanks

{{testcase table

| drug_name =

| CAS_number =

| trade_names=

| INN =

}}

{{testcase table

| CAS_number = 1234-56-7

| trade_names=no dn

}}

{{testcase table

| drug_name =

| CAS_number = 1234-56-7

| trade_names=blank dn

}}

{{testcase table

| drug_name = Infobox drug/testcases8

| CAS_number = 1234-56-7

| trade_names = dn=pagenm

}}

{{testcase table

| drug_name = Aspirin

| CAS_number = 1234-56-7

| trade_names=dn is diff

}}

{{testcase table

| CAS_number = 1234-56-7

| trade_names=no dn

| INN = inn

}}

{{testcase table

| drug_name =

| CAS_number = 1234-56-7

| trade_names=blank dn

| INN = inn

}}

{{testcase table

| drug_name = Infobox drug/testcases8

| CAS_number = 1234-56-7

| trade_names = dn=pagenm

| INN = inn

}}

{{testcase table

| drug_name = Aspirin

| CAS_number = 1234-56-7

| trade_names=dn is diff

| INN = inn

}}

{{testcase table

| CAS_number = 1234-56-7

| trade_names=no dn

| INN = none

}}

{{testcase table

| drug_name =

| CAS_number = 1234-56-7

| trade_names=blank dn

| INN = none

}}

{{testcase table

| drug_name = Infobox drug/testcases8

| CAS_number = 1234-56-7

| trade_names = dn=pagenm

| INN = None

}}

{{testcase table

| drug_name = Aspirin

| CAS_number = 1234-56-7

| trade_names=dn is diff

| INN = none

}}

{{testcase table

| drug_name = Infobox drug/testcases8

| INN = Infobox drug/testcases8

| CAS_number = 1234-56-7

| trade_names = dn=pagenm

}}

{{testcase table

| no_param_name=99

}}

{{purge}}

{{Testcase table

| type = IUPAC

| drug_name = 1/IUPAC

| captionLR = Cap LR

| imageL = L1 barcelona.svg

| imageR = Tabliczka_R1.svg

| widthL = 70px

| widthR = 90px

| altL = alt-L

| altR = alt-R

| Watchedfields = 103

| imagename = 2

| image = Racemic amphetamine 2.svg

| width = 175px

| alt = an example image

| image2 = D-Amphetamine-3D-balls.png

| width2 = 150px

| alt2 = another example image

| caption = some images

| IUPAC_name = 12

| trivial_name = some-name

| target = 13

| vaccine_type = Toxoid

| mab_type = F(ab')2

| source = xi/a

| component1 = 17

| class1 = 18

| component2 = 19

| class2 = 20

| component3 = 21

| class3 = 22

| component4 = 23

| class4 = 24

| tradename = 25

| tradename_pronunciation = twenty-five

| tradename_synonym = two dozen plus one

| Drugs.com = 27

| MedlinePlus = 29

| licence_CA = 29.5

| licence_EU = 30

| licence_US = 31

| DailyMedID = 32

| pregnancy_AU = B3

| pregnancy_US = C

| pregnancy_category = 35

| legal_AU = S4

| legal_CA = Schedule IV

| legal_UK = POM

| legal_US = Schedule III

| legal_UN = N II III

| legal_EU = Category 2 Precursor

| legal_status = RX

| dependency_liability = 43-1

| addiction_liability = 43-2

| routes_of_administration = 44

| bioavailability = 45

| protein_bound = 46

| metabolism = 47

| onset = 47.5

| elimination_half-life = 48

| excretion = 49

| CAS_number = 50

| CAS_number_Ref = 51

| CAS_supplemental = 52

| ATCvet = 53

| ATC_prefix = 54

| ATC_suffix = 55

| ATC_supplemental = 56

| PubChem = 57

| PubChemSubstance = 58

| IUPHAR_ligand = 59

| DrugBank = 60

| DrugBank_Ref = 101

| ChemSpiderID = 61

| ChemSpiderID_Ref = 62

| UNII = 63

| UNII_Ref = 64

| KEGG = 65

| KEGG_Ref = 66

| ChEBI = 67

| ChEBI_Ref = 68

| ChEMBL = 69

| ChEMBL_Ref = 70

| NIAID_ChemDB = 71

| synonyms = 72

| PDB_ligand = 73

| chemical_formula =

| C = 1

| H = 2

| Ag = 3

| Al = 4

| As = 5

| Au = 6

| B = 7

| Bi = 8

| charge = -1

| molecular_weight = 75

| show_all=yes

| smiles = 76

| StdInChI = 77

| StdInChI_comment = 78

| StdInChI_Ref = 79

| StdInChIKey = 80

| StdInChIKey_comment = 81

| StdInChIKey_Ref = 82

| density = 83

| melting_point = 84

| melting_high = 85

| melting_notes = 86

| boiling_point = 87

| boiling_high = 104

| boiling_notes = 88

| solubility = 89

| chirality = 106

| specific_rotation = 90

| sec_combustion = 91

| Verifiedfields = 92

| verifiedrevid = 93

}}

{{purge}} (reduced infobox)

:Current infobox title: {{strong|1= Diamorphine ({{abbr|INN|International Nonproprietary Name}})}}

: The new situation required an edit.

{{testcase table

| drug_name = Heroin

| INN = Diamorphine

| IUPAC_name = (5α,6α)-7,8-didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol diacetate

| image = Heroin - Heroine.svg

| image2 = Heroin-from-xtal-horizontal-3D-balls.png

| pronounce = {{IPAc-en|ˈ|h|ɛ|r|o:|ɪ|n}}

| Drugs.com = {{drugs.com|parent|heroin}}

| legal_AU = S9

| dependency_liability = Physical: Very high
Psychological: Very high

| addiction_liability = Very high

| routes_of_administration = Inhalation, transmucosal, intravenous, oral, intranasal, rectal, intramuscular

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 561-27-3

| ATC_prefix = N07

| ATC_suffix = BC06

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 27808

| PubChem = 5462328

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01452

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4575379

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8H672SHT8E

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 459324

| C=21 | H=23 | N=1 | O=5

| molecular_weight = 369.41 g/mol

| synonyms = Diamorphine, Diacetylmorphine, Acetomorphine, (Dual) Acetylated morphine, Morphine diacetate

}}